- SPARTEINE SULFATE
-
- $1.00 / 1KG
-
2019-07-06
- CAS:299-39-8
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | SPARTEINE SULFATE Basic information |
| | SPARTEINE SULFATE Chemical Properties |
| Melting point | 135°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Ethanol (Sparingly, Sonicated), Methanol (Slightly) | | form | buffered aqueous solution | | color | White to Pale Yellow | | biological source | goat | | Stability: | Hygroscopic | | InChI | InChI=1/C15H26N2.H2O4S/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17;1-5(2,3)4/h12-15H,1-11H2;(H2,1,2,3,4)/t12-,13-,14-,15+;/s3 | | InChIKey | FCEHFCFHANDXMB-WAZVWRGFNA-N | | SMILES | [C@@]12(CN3[C@]([H])(CCCC3)[C@]([H])(CN3CCCC[C@@]13[H])C2)[H].S(=O)(=O)(O)O |&1:0,3,9,17,r| |
| Risk Statements | 23/25-33 | | Safety Statements | 1-45 | | RIDADR | 1544 | | WGK Germany | WGK 2 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 10 - Combustible liquids |
| | SPARTEINE SULFATE Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | A class 1a antiarrhythmic agent; a sodium channel blocker. |
| | SPARTEINE SULFATE Preparation Products And Raw materials |
|