|
|
| | 4-Chloro-3-(trifluoromethyl)benzenesulfonyl chloride Basic information | | Uses |
| | 4-Chloro-3-(trifluoromethyl)benzenesulfonyl chloride Chemical Properties |
| Melting point | 28 °C | | Boiling point | 83-84°C/0.1mm | | density | 1.626±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | powder to lump to clear liquid | | color | White or Colorless to Yellow | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C7H3Cl2F3O2S/c8-6-2-1-4(15(9,13)14)3-5(6)7(10,11)12/h1-3H | | InChIKey | SSULGNXFUGLULI-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=C(Cl)C(C(F)(F)F)=C1 | | CAS DataBase Reference | 32333-53-2(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | 3261 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 |
| | 4-Chloro-3-(trifluoromethyl)benzenesulfonyl chloride Usage And Synthesis |
| Uses | 4-Chloro-3-(trifluoromethyl)benzenesulfonyl chloride can be used as an important intermediate in the synthesis of fine chemicals such as pesticides, pharmaceuticals, and dyes. | | Description | 4-Chloro-3-(trifluoromethyl)benzenesulfonyl chloride is obtained from 2-chloro-α,α,α-trifluorotoluene and chlorosulfuric acid in 65% oleum. The compound is used as an intermediate in the production of pesticides and dyes. | | Chemical Properties | 4-Chloro-m-trifluoromethylbenzenesulfonyl chloride can be hydrolyzed, aminated, etc. to produce a series of new biologically active compounds with a variety of applications. |
| | 4-Chloro-3-(trifluoromethyl)benzenesulfonyl chloride Preparation Products And Raw materials |
|