| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | 2-Hydroxy-4-methylbenzophenone Basic information |
| Product Name: | 2-Hydroxy-4-methylbenzophenone | | Synonyms: | 4'-Methyl-2-hydroxybenzophenone;Benzophenone, 2-Hydroxy-4-methyl-;Methanone, (2-hydroxy-4-methylphenyl)phenyl-;2-Hydroxy-4-methylbenzophenone | | CAS: | 3098-18-8 | | MF: | C14H12O2 | | MW: | 212.24 | | EINECS: | | | Product Categories: | | | Mol File: | 3098-18-8.mol |  |
| | 2-Hydroxy-4-methylbenzophenone Chemical Properties |
| Melting point | 62-65°C | | Boiling point | 234°C/15mmHg(lit.) | | density | 1.164±0.06 g/cm3(Predicted) | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 8.05±0.35(Predicted) | | color | White to Yellow to Green | | λmax | 375nm(MeOH (pH 11))(lit.) | | InChI | 1S/C14H12O2/c1-10-7-8-12(13(15)9-10)14(16)11-5-3-2-4-6-11/h2-9,15H,1H3 | | InChIKey | KIZCNUWGIVQQBK-UHFFFAOYSA-N | | SMILES | Cc1ccc(c(O)c1)C(=O)c2ccccc2 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 2914.50.3000 | | Storage Class | 11 - Combustible Solids |
| | 2-Hydroxy-4-methylbenzophenone Usage And Synthesis |
| Preparation | Preparation by Friedel–Crafts acylation of m-cresol, with benzoic acid in the presence of boron trifluoride at 160° for 2 h (94%) or in the presence of Amberlyst-15 in refluxing chlorobenzene for 65 h (37%) ; with benzoyl chloride in the presence of aluminium chloride at 75°, in nitrobenzene at 60° for 18 h (8%) or with titanium tetrachloride in the same conditions (17%). |
| | 2-Hydroxy-4-methylbenzophenone Preparation Products And Raw materials |
|