| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Hydroxy-5-methylbenzophenone Basic information |
| | 2-Hydroxy-5-methylbenzophenone Chemical Properties |
| Melting point | 83-85 °C (lit.) | | Boiling point | 312.08°C (rough estimate) | | density | 1.1035 (rough estimate) | | refractive index | 1.6000 (estimate) | | pka | 8.24±0.43(Predicted) | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | 1S/C14H12O2/c1-10-7-8-13(15)12(9-10)14(16)11-5-3-2-4-6-11/h2-9,15H,1H3 | | InChIKey | OQERFUGURPLBQH-UHFFFAOYSA-N | | SMILES | Cc1ccc(O)c(c1)C(=O)c2ccccc2 | | CAS DataBase Reference | 1470-57-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29145000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Hydroxy-5-methylbenzophenone Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 2-Hydroxy-5-methylbenzophenone is a general reagent used in the synthesis of anti-bacterial and anti-fungal agents. | | Preparation | Preparation by condensation of benzotrichloride with p-cresol, in the presence of aluminium chloride in carbon disulfide for 2 h (75%). The 6,12-diphenyl-2,8-dimethyl-6,12-epoxy-6H,12H-dibenzo[b,f] dioxocin, an intermediate compound, was also formed under these conditions (29%). This “dioxocin”, by hydrolysis with concentrated sulfuric acid at r.t., gave the expected ketone (91%); in the presence of aqueous sodium hydroxide in a water bath for 4 h (33%) or in 32–40% aqueous sodium hydroxide at 70–80° (67%). | | Synthesis Reference(s) | The Journal of Organic Chemistry, 38, p. 1924, 1973 DOI: 10.1021/jo00950a030 |
| | 2-Hydroxy-5-methylbenzophenone Preparation Products And Raw materials |
|