4-ETHOXY-2-NITROANILINE manufacturers
- 4-ETHOXY-2-NITROANILINE
-
- $50.00 / 1KG
-
2025-09-25
- CAS:616-86-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-ETHOXY-2-NITROANILINE Basic information |
| | 4-ETHOXY-2-NITROANILINE Chemical Properties |
| Melting point | 111-113 °C(lit.) | | Boiling point | 346.2±22.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 1.01±0.10(Predicted) | | Appearance | Brown to reddish brown Solid | | InChI | 1S/C8H10N2O3/c1-2-13-6-3-4-7(9)8(5-6)10(11)12/h3-5H,2,9H2,1H3 | | InChIKey | ISFYBUAVOZFROB-UHFFFAOYSA-N | | SMILES | CCOc1ccc(N)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 616-86-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, 4-ethoxy-2-nitro- (616-86-4) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29222900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-ETHOXY-2-NITROANILINE Usage And Synthesis |
| Chemical Properties | red to rust-brown crystals or crystalline powder | | Uses | 4-Ethoxy-2-nitroaniline is a biological environmental toxin. | | Uses | 4-Ethoxy-2-nitroaniline may be used in chemical synthesis. |
| | 4-ETHOXY-2-NITROANILINE Preparation Products And Raw materials |
|