| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4'-Amino-5'-nitrobenzo-15-crown-5 Basic information |
| Product Name: | 4'-Amino-5'-nitrobenzo-15-crown-5 | | Synonyms: | 4'-Amino-5'-nitrobenzo-15-crown-5 97%;1,4,7,10,13-Benzopentaoxacyclopentadecin-15-amine, 2,3,5,6,8,9,11,12-octahydro-16-nitro-;17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-18-amine;4,-Amino-5'-nitrobenzo-15-crown-5;4'-Amino-5'-nitrobenzo-15-crown-5;4′-Amino-5′-nitrobenzo-15-crown-5, CAS 77001-50-4;4,-Amino-5'-nitrobenzo-15-crown-5;16-Nitro-2,3,5,6,8,9,11,12-octahydrobenzo[b][1,4,7,10,13]pentaoxacyclopentadecin-15-amine | | CAS: | 77001-50-4 | | MF: | C14H20N2O7 | | MW: | 328.32 | | EINECS: | | | Product Categories: | Chelation/Complexation Compounds;Crown Ethers;Synthetic Reagents | | Mol File: | 77001-50-4.mol |  |
| | 4'-Amino-5'-nitrobenzo-15-crown-5 Chemical Properties |
| Melting point | 148-151 °C(lit.) | | form | solid | | InChI | 1S/C14H20N2O7/c15-11-9-13-14(10-12(11)16(17)18)23-8-6-21-4-2-19-1-3-20-5-7-22-13/h9-10H,1-8,15H2 | | InChIKey | PSFJQUGCUJJHIS-UHFFFAOYSA-N | | SMILES | Nc1cc2OCCOCCOCCOCCOc2cc1[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | F | 9 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4'-Amino-5'-nitrobenzo-15-crown-5 Usage And Synthesis |
| | 4'-Amino-5'-nitrobenzo-15-crown-5 Preparation Products And Raw materials |
| Raw materials | N-(16-Nitro-2,3,5,6,8,9,11,12-octahydro-1,4,7,10,13-benzopentaoxacyclopentadecin-15-yl)acetamide-->4-Nitrobenzo-15-crown-5-->Benzo-15-crown-5 |
|