- Benzenesulfonanilide
-
- $10.00 / 1KG
-
2024-01-14
- CAS:1678-25-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- Benzenesulfonanilide
-
- $9.80 / 1.79999995231628KG
-
2020-01-10
- CAS:1678-25-7
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | Benzenesulfonanilide Basic information |
| Product Name: | Benzenesulfonanilide | | Synonyms: | BENZENESULFONANILIDE;N-phenylbenzenesulphonamide;BENZENESULFONANILIDE 98+%;Benzenesulphanilide;N-Phenylbenzolsulfonamid;N-Phenylbenzenesulfonamidebenzenesulfonanilide;N-PHENYLBENZENESULFONAMIDE;Benzenesulfanilide | | CAS: | 1678-25-7 | | MF: | C12H11NO2S | | MW: | 233.29 | | EINECS: | 216-832-4 | | Product Categories: | API intermediates | | Mol File: | 1678-25-7.mol |  |
| | Benzenesulfonanilide Chemical Properties |
| Melting point | 110°C | | Boiling point | 220.4°C (rough estimate) | | density | 1.2503 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Store at room temperature | | solubility | soluble in Methanol | | pka | 8.51±0.10(Predicted) | | form | Solid | | color | White to Almost white | | InChI | InChI=1S/C12H11NO2S/c14-16(15,12-9-5-2-6-10-12)13-11-7-3-1-4-8-11/h1-10,13H | | InChIKey | XAUGWFWQVYXATQ-UHFFFAOYSA-N | | SMILES | C1(S(NC2=CC=CC=C2)(=O)=O)=CC=CC=C1 | | CAS DataBase Reference | 1678-25-7(CAS DataBase Reference) | | NIST Chemistry Reference | N-phenyl-benzene-sulfonamide(1678-25-7) |
| Safety Statements | 22-24/25 | | RTECS | DB3500000 | | HS Code | 2921.42.9000 |
| | Benzenesulfonanilide Usage And Synthesis |
| Safety Profile | Questionable carcinogen withexperimental tumorigenic data. When heated todecomposition it emits very toxic fumes of SOx and NOx. |
| | Benzenesulfonanilide Preparation Products And Raw materials |
|