|
|
| | 4-(2-Aminoethyl)-1-benzylpiperidine Basic information |
| | 4-(2-Aminoethyl)-1-benzylpiperidine Chemical Properties |
| Melting point | 175-178 °C | | Boiling point | 175-184 °C(Press: 0.1 Torr) | | density | 0,99 g/cm3 | | refractive index | 1.5320-1.5350 | | storage temp. | 2-8°C, protect from light | | pka | 10.43±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C14H22N2/c15-9-6-13-7-10-16(11-8-13)12-14-4-2-1-3-5-14/h1-5,13H,6-12,15H2 | | InChIKey | OUYRPOHWEJUTCQ-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=CC=C2)CCC(CCN)CC1 | | CAS DataBase Reference | 86945-25-7(CAS DataBase Reference) |
| Hazard Codes | T,Xi | | Risk Statements | 36/37/38-41-25 | | Safety Statements | 26-36/37/39-45-39 | | WGK Germany | WGK 3 | | HS Code | 2933.39.9200 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
| | 4-(2-Aminoethyl)-1-benzylpiperidine Usage And Synthesis |
| | 4-(2-Aminoethyl)-1-benzylpiperidine Preparation Products And Raw materials |
|