|
| 4-(2-Aminoethyl)-1-benzylpiperidine Basic information |
| 4-(2-Aminoethyl)-1-benzylpiperidine Chemical Properties |
Boiling point | 175-184 °C(Press: 0.1 Torr) | density | 0,99 g/cm3 | refractive index | 1.5320-1.5350 | storage temp. | 2-8°C, protect from light | pka | 10.43±0.10(Predicted) | form | clear liquid | color | Colorless to Light yellow | InChI | InChI=1S/C14H22N2/c15-9-6-13-7-10-16(11-8-13)12-14-4-2-1-3-5-14/h1-5,13H,6-12,15H2 | InChIKey | OUYRPOHWEJUTCQ-UHFFFAOYSA-N | SMILES | N1(CC2=CC=CC=C2)CCC(CCN)CC1 | CAS DataBase Reference | 86945-25-7(CAS DataBase Reference) |
| 4-(2-Aminoethyl)-1-benzylpiperidine Usage And Synthesis |
| 4-(2-Aminoethyl)-1-benzylpiperidine Preparation Products And Raw materials |
|