|
|
| | H-PHE-TYR-GLY-PRO-VAL-OH Basic information |
| Product Name: | H-PHE-TYR-GLY-PRO-VAL-OH | | Synonyms: | BONE GLA PROTEIN (45-49);HUMAN BONE GLA PROTEIN 45-49 FRAGMENT;H-PHE-TYR-GLY-PRO-VAL-OH;FYGPV;PHE-TYR-GLY-PRO-VAL;OSTEOCALCIN (45-49) (HUMAN);OSTEOCALCIN, FRAGMENT 45-49;OSTEOCALCIN FRAGMENT 45-49 HUMAN | | CAS: | 85679-70-5 | | MF: | C30H39N5O7 | | MW: | 581.66 | | EINECS: | | | Product Categories: | peptide | | Mol File: | 85679-70-5.mol |  |
| | H-PHE-TYR-GLY-PRO-VAL-OH Chemical Properties |
| storage temp. | -20°C | | form | Solid | | InChIKey | MJAFJCRCGVXXTP-UHFFFAOYSA-N | | SMILES | CC(C)C(NC(=O)C1CCCN1C(=O)CNC(=O)C(Cc2ccc(O)cc2)NC(=O)C(N)Cc3ccccc3)C(O)=O |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | H-PHE-TYR-GLY-PRO-VAL-OH Usage And Synthesis |
| Uses | Bone Gla Protein (45-49) is the 45-49 fragment of gamma-carboxyglutamic acid (GLA)-containing protein from bone (BGP, osteocalcin), which has chemotactic activity in vitro for a number of cells which are found adjacent to endosteal bone surfaces in vivo[1]. | | References | [1] Mundy GR, et al. Chemotactic activity of the gamma-carboxyglutamic acid containing protein in bone. Calcif Tissue Int. 1983;35(2):164-8. DOI:10.1007/BF02405025 |
| | H-PHE-TYR-GLY-PRO-VAL-OH Preparation Products And Raw materials |
|