2-METHYL-2H-BENZOTRIAZOLE manufacturers
- 2-methylbenzotriazole
-
- $110.00 / 1kg
-
2023-02-13
- CAS:16584-00-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100MT
|
| | 2-METHYL-2H-BENZOTRIAZOLE Basic information |
| Product Name: | 2-METHYL-2H-BENZOTRIAZOLE | | Synonyms: | 2-METHYL-2H-BENZOTRIAZOLE;2-Methyl-2H-1,2,3-benzotriazole;2-Methylbenzotriazole;2H-Benzotriazole, 2-methyl-;2-Methyl-2H-benzo[d][1,2,3]triazole;2-Methyl-1,2,3-benzotriazole | | CAS: | 16584-00-2 | | MF: | C7H7N3 | | MW: | 133.15 | | EINECS: | | | Product Categories: | | | Mol File: | 16584-00-2.mol |  |
| | 2-METHYL-2H-BENZOTRIAZOLE Chemical Properties |
| Boiling point | 108-112 °C(Press: 22 Torr) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 2.24±0.30(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H7N3/c1-10-8-6-4-2-3-5-7(6)9-10/h2-5H,1H3 | | InChIKey | PWORFEDVDWBHSJ-UHFFFAOYSA-N | | SMILES | N1=C2C=CC=CC2=NN1C | | CAS DataBase Reference | 16584-00-2 |
| | 2-METHYL-2H-BENZOTRIAZOLE Usage And Synthesis |
| | 2-METHYL-2H-BENZOTRIAZOLE Preparation Products And Raw materials |
|