| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | OGERIN NEGATIVE CONTROL Basic information |
| Product Name: | OGERIN NEGATIVE CONTROL | | Synonyms: | OGERIN NEGATIVE CONTROL;Benzenemethanol, 3-[4-amino-6-[(phenylmethyl)amino]-1,3,5-triazin-2-yl]-;Ogerin negative control >=98% (HPLC) | | CAS: | 1125453-08-8 | | MF: | C17H17N5O | | MW: | 307.35 | | EINECS: | | | Product Categories: | | | Mol File: | 1125453-08-8.mol |  |
| | OGERIN NEGATIVE CONTROL Chemical Properties |
| Boiling point | 623.8±65.0 °C(Predicted) | | density | 1.332±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 20mg/mL, clear | | form | powder | | pka | 14.14±0.10(Predicted) | | color | white to beige | | InChI | 1S/C17H17N5O/c18-16-20-15(14-8-4-7-13(9-14)11-23)21-17(22-16)19-10-12-5-2-1-3-6-12/h1-9,23H,10-11H2,(H3,18,19,20,21,22) | | InChIKey | RVKAHYFWSKSSQQ-UHFFFAOYSA-N | | SMILES | NC1=NC(C2=CC(CO)=CC=C2)=NC(NCC3=CC=CC=C3)=N1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | OGERIN NEGATIVE CONTROL Usage And Synthesis |
| Uses | Ogerin analogue 1 (compound 20) is a structural analog of Ogerin (HY-110279). Ogerin analogue 1 is generally used as a negative control[1]. | | Biochem/physiol Actions | Ogerin negative control is a structurally similar analog of ogerin (catalog no. SML1482). Ogerin is a selective positive allosteric modulator of an orphan GPCR, GPR68, also known as Ovarian cancer G-protein coupled receptor 1 (OGR1). GPR68 is one of the proton or pH-sensing GPCRs that sense extracellular H(+). Ogerin potently potentiated proton-mediated GPR68-Gs signaling. The meta-analog is inactive and serves as a negative control. | | References | [1] Yu X, et al. Design, Synthesis, and Characterization of Ogerin-Based Positive Allosteric Modulators for G Protein-Coupled Receptor 68 (GPR68). J Med Chem. 2019 Aug 22;62(16):7557-7574. DOI:10.1021/acs.jmedchem.9b00869 |
| | OGERIN NEGATIVE CONTROL Preparation Products And Raw materials |
|