| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | 3-Methyl-3-(4-methylphenyl)butanoic acid Basic information |
| Product Name: | 3-Methyl-3-(4-methylphenyl)butanoic acid | | Synonyms: | 3-Methyl-3-(4-methylphenyl)buranoic acid;2-(DICHLOROMETHYL)PYRIDINE HCL;3-Methyl-3-p-tolylbutanoic acid;3-Methyl-3-p-tolyl-butyric acid;3-METHYL-3-(4-METHYLPHENYL)BUTYRIC ACID;3-methyl-3-(4-methylphenyl)butanoate;Benzenepropanoic acid, β,β,4-trimethyl-;3-Methyl-3-(4-methylphenyl)butanoic acid | | CAS: | 42288-08-4 | | MF: | C12H16O2 | | MW: | 192.25 | | EINECS: | | | Product Categories: | | | Mol File: | 42288-08-4.mol |  |
| | 3-Methyl-3-(4-methylphenyl)butanoic acid Chemical Properties |
| Melting point | 75℃ | | Boiling point | 306.5±11.0 °C(Predicted) | | density | 1.047 | | pka | 4.73±0.10(Predicted) | | form | solid | | InChI | 1S/C12H16O2/c1-9-4-6-10(7-5-9)12(2,3)8-11(13)14/h4-7H,8H2,1-3H3,(H,13,14) | | InChIKey | LXMASNUOAKLCJK-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)C(C)(C)CC(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Methyl-3-(4-methylphenyl)butanoic acid Usage And Synthesis |
| | 3-Methyl-3-(4-methylphenyl)butanoic acid Preparation Products And Raw materials |
|