|
|
| | 3-Methylanthranilic acid Basic information | | Uses |
| | 3-Methylanthranilic acid Chemical Properties |
| Melting point | 174-177 °C (lit.) | | Boiling point | 273.17°C (rough estimate) | | density | 1.2023 (rough estimate) | | refractive index | 1.5810 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | form | Crystalline Powder | | pka | 5.01±0.10(Predicted) | | color | Pink to gray-brown | | BRN | 2359694 | | Major Application | peptide synthesis | | InChI | InChI=1S/C8H9NO2/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,9H2,1H3,(H,10,11) | | InChIKey | WNAJXPYVTFYEST-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(C)=C1N | | CAS DataBase Reference | 4389-45-1(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Amino-3-methylbenzoic acid(4389-45-1) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Methylanthranilic acid Usage And Synthesis |
| Uses | 2-Amino-3-methylbenzoic acid is a metabolite of Lidocaine, an antiarrythmic drug that is used to treat patients with ventricular fibrillation. 2-Amino-3-methylbenzoic acid has potential herbicidal activity, and is also used as a reagent to synthesize Ropicavaine, a local anasthetic. | | Chemical Properties | pink to grey-brown crystalline powder | | Uses | 2-Amino-3-methylbenzoic acid is a metabolite of Lidocaine (L397800), an antiarrythmic drug that is used to treat patients with ventricular fibrillation. 2-Amino-3-methylbenzoic acid has potential herbicidal activity, and is also used as a reagent to synthesize Ropicavaine (R675000), a local anasthetic. | | Definition | ChEBI: 2-Amino-3-methylbenzoate is an aminobenzoic acid. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 3-Methylanthranilic acid Preparation Products And Raw materials |
|