|
|
| | 1,3,5[10]-ESTRATRIEN-3-OL-17-ONE 3-GLUCURONIDE SODIUM SALT Basic information |
| Product Name: | 1,3,5[10]-ESTRATRIEN-3-OL-17-ONE 3-GLUCURONIDE SODIUM SALT | | Synonyms: | ESTRONE-3-(BETA-D-GLUCURONIDE SODIUM SALT);ESTRONE-3-GLUCURONIDE SODIUM SALT;ESTRONE BETA-D-GLUCURONIDE SODIUM SALT;ESTRONE GLUCURONIDE, SODIUM SALT;3-HYDROXY-1,3,5[10]-ESTRATRIEN-17-ONE 3-GLUCURONIDE SODIUM SALT;1,3,5(10)-ESTRATRIEN-3-OL-17-ONE GLUCOSIDURONATE, SODIUM SALT;1,3,5[10]-ESTRATRIEN-3-OL-17-ONE 3-GLUCURONIDE SODIUM SALT;1,3,5(10)-ESTRATRIEN-3-OL-17-ONE 3(O->1BETA)-D-GLUCOPYRANOSIDURONIC ACID SODIUM SALT | | CAS: | 15087-01-1 | | MF: | C24H30O8.Na | | MW: | 469.48 | | EINECS: | | | Product Categories: | Pharmaceuticals;Steroids;Glucuronides;Intermediates & Fine Chemicals;Metabolites & Impurities | | Mol File: | 15087-01-1.mol | ![1,3,5[10]-ESTRATRIEN-3-OL-17-ONE 3-GLUCURONIDE SODIUM SALT Structure](CAS/GIF/15087-01-1.gif) |
| | 1,3,5[10]-ESTRATRIEN-3-OL-17-ONE 3-GLUCURONIDE SODIUM SALT Chemical Properties |
| Melting point | 286-290C (dec.) | | storage temp. | −20°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated), Water (Slightly) | | form | Solid | | color | White to Pale Brown | | Water Solubility | water: 20mg/mL, clear, colorless | | BRN | 6043458 | | Stability: | Hygroscopic | | InChIKey | PBULYLQKWDXDFZ-QHIGSJCSSA-M | | SMILES | [Na+].[H][C@]12CC[C@]3(C)C(=O)CC[C@@]3([H])[C@]1([H])CCc4cc(O[C@@H]5O[C@@H]([C@@H](O)[C@H](O)[C@H]5O)C([O-])=O)ccc24 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 29379000 | | Storage Class | 11 - Combustible Solids |
| | 1,3,5[10]-ESTRATRIEN-3-OL-17-ONE 3-GLUCURONIDE SODIUM SALT Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of 17β -Estradiol (E888000). | | Biological Activity | Estrone 3 glucuronide (E3G) is a urinary metabolite of estrogen. Higher levels of estrone 3 glucuronide are observed during the early onset of the fertile period of the menstrual cycle. |
| | 1,3,5[10]-ESTRATRIEN-3-OL-17-ONE 3-GLUCURONIDE SODIUM SALT Preparation Products And Raw materials |
|