| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 1,3,5(10)-ESTRATRIEN-3-OL-17-ONE 3(O->1BETA)-D-GLYCOPYRANOSIDURONIC ACID Basic information |
| Product Name: | 1,3,5(10)-ESTRATRIEN-3-OL-17-ONE 3(O->1BETA)-D-GLYCOPYRANOSIDURONIC ACID | | Synonyms: | 1,3,5(10)-ESTRATRIEN-3-OL-17-ONE 3(O->1BETA)-D-GLYCOPYRANOSIDURONIC ACID;1,3,5(10)-ESTRATRIEN-3-OL-17-ONE GLUCOSIDURONATE;ESTRONE-BETA-GLUCURONIDE;17-Oxoestra-1,3,5(10)-trien-3-yl b-D-Glucopyranosiduronic Acid;Estrone b-D-Glucuronide;Estrone b-Glucuronide;Estrone Glucosiduronate;(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[(8S,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-2-carboxylic acid | | CAS: | 2479-90-5 | | MF: | C24H30O8 | | MW: | 446.49 | | EINECS: | | | Product Categories: | Glucuronides;Metabolites & Impurities;Steroids | | Mol File: | 2479-90-5.mol |  |
| | 1,3,5(10)-ESTRATRIEN-3-OL-17-ONE 3(O->1BETA)-D-GLYCOPYRANOSIDURONIC ACID Chemical Properties |
| Melting point | 254.5 | | Boiling point | 703.8±60.0 °C(Predicted) | | density | 1.419±0.06 g/cm3(Predicted) | | pka | 2.80±0.70(Predicted) | | form | powder | | color | white to off-white | | Major Application | metabolomics | | InChIKey | FJAZVHYPASAQKM-JBAURARKSA-N | | SMILES | C[C@@]12[C@](CCC2=O)([H])[C@@]3([H])[C@@](CC1)([H])C4=CC=C(O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C(O)=O)O)O)O)C=C4CC3 | | EPA Substance Registry System | .beta.-D-Glucopyranosiduronic acid, 17-oxoestra-1,3,5(10)-trien-3-yl (2479-90-5) |
| | 1,3,5(10)-ESTRATRIEN-3-OL-17-ONE 3(O->1BETA)-D-GLYCOPYRANOSIDURONIC ACID Usage And Synthesis |
| Uses | A metabolite of 17 -Estradiol | | Uses | Estrone β-D-Glucuronide is a metabolite of 17β -Estradiol (E888000), the major estrogen (1) secreted by the premenopausal ovary (2). | | Definition | ChEBI: Estrone 3-O-(beta-D-glucuronide) is the 3-beta-D-glucuronide of estrone. It has a role as a human metabolite and a mouse metabolite. It is a 17-oxo steroid, a beta-D-glucosiduronic acid and a steroid glucosiduronic acid. It is functionally related to an estrone. It is a conjugate acid of an estrone 3-O-(beta-D-glucuronide)(1-). | | IC 50 | Human Endogenous Metabolite |
| | 1,3,5(10)-ESTRATRIEN-3-OL-17-ONE 3(O->1BETA)-D-GLYCOPYRANOSIDURONIC ACID Preparation Products And Raw materials |
|