|
|
| | 3-(Fmoc-4-aminophenyl)-propionic acid Basic information |
| Product Name: | 3-(Fmoc-4-aminophenyl)-propionic acid | | Synonyms: | Fmoc-3-(4-aminophenyl)-propionic acid;3-(4-((((9H-Fluoren-9-yl)Methoxy)carbonyl)aMino)phenyl)propanoic acid;3-[4-amino-2-[9H-fluoren-9-ylmethoxy(oxo)methyl]phenyl]propanoic acid;Benzenepropanoic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-;3-[4-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)phenyl]propanoic acid;3-[4-(Fmoc-amino)phenyl]propanoic Acid;3-(Fmoc-4-aminophenyl)-propionic acid | | CAS: | 882847-07-6 | | MF: | C24H21NO4 | | MW: | 387.43 | | EINECS: | | | Product Categories: | | | Mol File: | 882847-07-6.mol |  |
| | 3-(Fmoc-4-aminophenyl)-propionic acid Chemical Properties |
| Boiling point | 567.0±38.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 4.67±0.10(Predicted) | | InChI | 1S/C24H21NO4/c26-23(27)14-11-16-9-12-17(13-10-16)25-24(28)29-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-10,12-13,22H,11,14-15H2,(H,25,28)(H,26,27) | | InChIKey | KPJLWYDRVBUVDL-UHFFFAOYSA-N | | SMILES | OC(=O)CCc1ccc(NC(=O)OCC2c3ccccc3-c4ccccc24)cc1 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | 3-(Fmoc-4-aminophenyl)-propionic acid Usage And Synthesis |
| Chemical Properties | White powder |
| | 3-(Fmoc-4-aminophenyl)-propionic acid Preparation Products And Raw materials |
|