|
|
| | 2-Amino-5-nitro-4-methyl-1,3-thiazole Basic information |
| Product Name: | 2-Amino-5-nitro-4-methyl-1,3-thiazole | | Synonyms: | 4-Methyl-5-nitro-2-thiazoleaMine;2-Amino-4-methyl-5-nitrothiazole;4-METHYL-5-NITRO-2-THIAZOLAMINE;4-methyl-5-nitro-1,3-thiazol-2-amine;2-Thiazolamine, 4-methyl-5-nitro-;2-Amino-4-methyl-5-nitrothiazo;4-Methyl-5-nitrothiazol-2-aMine;2-Amino-5-nitro-4-methyl-1,3-thiazole | | CAS: | 56682-07-6 | | MF: | C4H5N3O2S | | MW: | 159.17 | | EINECS: | | | Product Categories: | | | Mol File: | 56682-07-6.mol |  |
| | 2-Amino-5-nitro-4-methyl-1,3-thiazole Chemical Properties |
| Melting point | 205-207 °C | | Boiling point | 337.7±22.0 °C(Predicted) | | density | 1.552±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.59±0.10(Predicted) | | Appearance | Brown to dark brown Solid | | InChI | InChI=1S/C4H5N3O2S/c1-2-3(7(8)9)10-4(5)6-2/h1H3,(H2,5,6) | | InChIKey | NDWBXTNRCBNGAK-UHFFFAOYSA-N | | SMILES | S1C([N+]([O-])=O)=C(C)N=C1N |
| | 2-Amino-5-nitro-4-methyl-1,3-thiazole Usage And Synthesis |
| | 2-Amino-5-nitro-4-methyl-1,3-thiazole Preparation Products And Raw materials |
|