|
|
| | 1-Boc-4-(4-bromo-phenylamino)-piperidine Basic information |
| Product Name: | 1-Boc-4-(4-bromo-phenylamino)-piperidine | | Synonyms: | 4-(4-BROMO-PHENYLAMINO)-PIPERIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;tert-butyl 4-(4-bromoanilino)piperidine-1-carboxylate;TERT-BUTYL 4-(4-BROMOPHENYLAMINO)-PIPERIDINE-1-CARBOXYLATE;4-(4-Bromophenyl)amino-1-(tert-butoxycarbonyl)piperidine;1-Piperidinecarboxylic acid, 4-[(4-bromophenyl)amino]-,1,1-dimethylethyl ester;4-(4-bromophenyl) amino;Hot selling 1-BOC-4-(4-BROMO-PHENYLAMINO)-PIPERIDINE;1-BOC-4-(4-BROMO-PHENYLAMINO)-PIPERIDINE CAS 443998-65-0 | | CAS: | 443998-65-0 | | MF: | C16H23BrN2O2 | | MW: | 355.27 | | EINECS: | 202-303-5 | | Product Categories: | 443998-65-0 | | Mol File: | 443998-65-0.mol |  |
| | 1-Boc-4-(4-bromo-phenylamino)-piperidine Chemical Properties |
| Boiling point | 439.1±40.0 °C(Predicted) | | density | 1.336±0.06 g/cm3(Predicted) | | pka | 4.18±0.20(Predicted) | | InChI | InChI=1S/C16H23BrN2O2/c1-16(2,3)21-15(20)19-10-8-14(9-11-19)18-13-6-4-12(17)5-7-13/h4-7,14,18H,8-11H2,1-3H3 | | InChIKey | ZDCRNXMZSKCKRF-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(NC2=CC=C(Br)C=C2)CC1 |
| | 1-Boc-4-(4-bromo-phenylamino)-piperidine Usage And Synthesis |
| Uses | 1-Boc-4-(4-bromo-phenylamino)-piperidine is a piperidine organic compound, which can be used as a pharmaceutical intermediate for pharmaceutical research and scientific research. |
| | 1-Boc-4-(4-bromo-phenylamino)-piperidine Preparation Products And Raw materials |
|