|
|
| | 2-DIMETHYLAMINO-PYRIMIDINE-5-CARBALDEHYDE Basic information |
| Product Name: | 2-DIMETHYLAMINO-PYRIMIDINE-5-CARBALDEHYDE | | Synonyms: | 2-DIMETHYLAMINO-PYRIMIDINE-5-CARBALDEHYDE;CHEMBRDG-BB 4010270;ASISCHEM C63425;2-(dimethylamino)pyrimidine-5-carbaldehyde(SALTDATA: FREE);5-Pyrimidinecarboxaldehyde, 2-(dimethylamino)-;2-(N,N-DiMethylaMino)pyriMidine-5-carboxaldehyde;TIMTEC-BB SBB010324;2-DIMETHYLAMINO-PYRIMIDINE-5-CARBALDEHYDE ISO 9001：2015 REACH | | CAS: | 55551-49-0 | | MF: | C7H9N3O | | MW: | 151.17 | | EINECS: | | | Product Categories: | Building Blocks;Pyrimidine | | Mol File: | 55551-49-0.mol |  |
| | 2-DIMETHYLAMINO-PYRIMIDINE-5-CARBALDEHYDE Chemical Properties |
| Melting point | 122-124 °C | | Boiling point | 289.6±32.0 °C(Predicted) | | density | 1.204±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.27±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H9N3O/c1-10(2)7-8-3-6(5-11)4-9-7/h3-5H,1-2H3 | | InChIKey | XBYXYDVSCMMJDT-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=NC=C(C=O)C=N1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-43 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-DIMETHYLAMINO-PYRIMIDINE-5-CARBALDEHYDE Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 2-dimethylaminopyrimidine-5-carbaldehyde from 2-chloropyrimidine-5-carbaldehyde: 2-chloropyrimidine-5-carbaldehyde (412 mg, 2.89 mmol) and triethylamine (Et3N, 482 μL, 3.47 mmol) were dissolved in dioxane (20 mL), followed by the addition of a solution of dimethylamine (Me2NH) in tetrahydrofuran (THF) (1.59 mL, 2.0 M, 3.18 mmol). The reaction mixture was stirred at room temperature for 1 h. After completion of the reaction, the reaction solution was filtered and the solid was washed with dioxane (5 mL). The filtrate was concentrated under vacuum to give 2-dimethylaminopyrimidine-5-carbaldehyde (427 mg, 97.7% yield) as a yellow solid. The product was analyzed by LC-MS (ES+) and showed a molecular ion peak [MH]+ of 152.2. HPLC analysis showed a retention time (Rt) of 4.14 min and a purity of 97.9%. | | References | [1] Patent: US2015/258101, 2015, A1 |
| | 2-DIMETHYLAMINO-PYRIMIDINE-5-CARBALDEHYDE Preparation Products And Raw materials |
|