| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| Product Name: | CEGABA | | Synonyms: | 4-(2-CARBOXY-ETHYLAMINO)-BUTYRIC ACID;CARBOXYETHYL-GAMMA-AMINO-BUTYRIC ACID;CEGABA;2-carboxyethylgamma-aminobutyricacid;4-((2-carboxyethyl)amino)-butanoicaci;4-((2-carboxyethyl)amino)butanoicacid;4-((2-carboxyethyl)amino)-butyricaci;spermidicacid | | CAS: | 4386-03-2 | | MF: | C7H13NO4 | | MW: | 175.18 | | EINECS: | 224-497-0 | | Product Categories: | | | Mol File: | 4386-03-2.mol |  |
| | CEGABA Chemical Properties |
| solubility | cell culture medium: 1.5 mg/mL Store solution at −20°C. | | form | powder | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C7H13NO4/c9-6(10)2-1-4-8-5-3-7(11)12/h8H,1-5H2,(H,9,10)(H,11,12) | | InChIKey | SRGQUICKDUQCKO-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCNCCC(O)=O | | LogP | 0.146 (est) |
| WGK Germany | 3 | | RTECS | EK7730000 | | Toxicity | mouse,LD50,intraperitoneal,783mg/kg (783mg/kg),Italian Journal of Biochemistry. Vol. 33, Pg. 31A, 1984. |
| | CEGABA Usage And Synthesis |
| Uses | Spermidic Acid is a useful research chemical used in dietary resistant starch preserved through mild extrusion of grain alters fecal microbiome metabolism of dietary macronutrients while increasing Ig in cat. It is also used in cosmetic treatment for improvement of esthetic aspect and physical-mechanical characteristics of keratins using sulfo-carboxylate molecule pincers. | | Definition | ChEBI: N-carboxyethyl-gamma-aminobutyric acid is an organonitrogen compound and an organooxygen compound. It is functionally related to a gamma-amino acid. |
| | CEGABA Preparation Products And Raw materials |
|