|
|
| | 4,4-DIMETHYL-2-CYCLOHEXEN-1-ONE Basic information |
| Product Name: | 4,4-DIMETHYL-2-CYCLOHEXEN-1-ONE | | Synonyms: | 6,6-Dimethylcyclohexen-3-one;4,4-DiMethyl-2-cyclohexen-1-one, 97% 5GR;4,4-Dimethylcyclohex-2-en-1-one 97%;4,4-DIMETHYL-2-CYCLOHEXEN-1-ONE;4,4-DIMETHYL-2-CYCLOHEXENE-1-ONE;4,4-Dimethyl-2-cyclohexenone;4,4-Dimethylcyclohexenone;4,4-DIMETHYL-2-CYCLOHEXEN-1-ONE, 97+% | | CAS: | 1073-13-8 | | MF: | C8H12O | | MW: | 124.18 | | EINECS: | | | Product Categories: | blocks;BuildingBlocks;C7 to C8;Carbonyl Compounds;Ketones | | Mol File: | 1073-13-8.mol |  |
| | 4,4-DIMETHYL-2-CYCLOHEXEN-1-ONE Chemical Properties |
| Boiling point | 72-73.5 °C20 mm Hg(lit.) | | density | 0.944 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.473(lit.) | | Fp | 148 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | Specific Gravity | 0.944 | | color | Clear dark brown | | Sensitive | Air Sensitive | | λmax | 318nm(EtOH)(lit.) | | InChI | InChI=1S/C8H12O/c1-8(2)5-3-7(9)4-6-8/h3,5H,4,6H2,1-2H3 | | InChIKey | HAUNPYVLVAIUOO-UHFFFAOYSA-N | | SMILES | C1(=O)CCC(C)(C)C=C1 | | LogP | 1.480 (est) | | CAS DataBase Reference | 1073-13-8(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36-20/21/22 | | Safety Statements | 36/37/39-26 | | WGK Germany | 3 | | HS Code | 29142990 | | Storage Class | 10 - Combustible liquids |
| | 4,4-DIMETHYL-2-CYCLOHEXEN-1-ONE Usage And Synthesis |
| Chemical Properties | CLEAR DARK BROWN LIQUID | | Synthesis Reference(s) | Journal of the American Chemical Society, 104, p. 4990, 1982 DOI: 10.1021/ja00382a061 The Journal of Organic Chemistry, 45, p. 5399, 1980 DOI: 10.1021/jo01314a048 |
| | 4,4-DIMETHYL-2-CYCLOHEXEN-1-ONE Preparation Products And Raw materials |
|