|
|
| | (+)-Limonene 1 2-epoxide Basic information |
| Product Name: | (+)-Limonene 1 2-epoxide | | Synonyms: | (1RS,2SR,4R)-limonene-1,2-epoxide;(+)-p-Mentha-1,8-diene 1,2-epoxide, (4R)-1,2-Epoxy-p-menth-8-ene, (4R)-4-Isopropenyl-1-methyl-1-cyclohexene 1,2-epoxide;(R)-Limonene 1,2-epoxide (Mixture of Diastereomers);(+)-p-mentha-1,8-diene 1,2-epoxide;7-Oxabicyclo[4.1.0]heptane,1-methyl-4-(1-methylethenyl)-,(4R)-(9CI);(4R)-1-Methyl-4-(1-Methylethenyl)-7-oxabicyclo[4.1.0]heptane;(R)-LiMonene Epoxide;(+)-LiMonene oxide, Mixture of cis and trans 97% | | CAS: | 203719-54-4 | | MF: | C10H16O | | MW: | 152.23 | | EINECS: | | | Product Categories: | Miscellaneous Reagents;EPOXYDE;Chiral Reagents | | Mol File: | 203719-54-4.mol |  |
| | (+)-Limonene 1 2-epoxide Chemical Properties |
| density | 0.930 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.467 | | Fp | 65 °C | | storage temp. | 2-8°C | | solubility | Dichloromethane, Ether | | form | Oil | | color | Colourless | | Odor | at 100.00 %. green citrus fruity | | Odor Type | green | | BRN | 80231 | | Boiling point | 113-114°C/50 mmHg(lit.) | | InChI | 1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9,10/m1/s1 | | InChIKey | CCEFMUBVSUDRLG-XNWIYYODSA-N | | SMILES | CC(=C)[C@@H]1CCC2(C)OC2C1 | | LogP | 3.20 |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 1-10 | | HS Code | 2932990090 | | Storage Class | 10 - Combustible liquids |
| | (+)-Limonene 1 2-epoxide Usage And Synthesis |
| Chemical Properties | (+)-LIMONENE 1 2-EPOXIDE is Colourless oil | | Uses | Oxidized Limonene, a common reagent used in the preparation of fragrant compounds. | | Uses | (+)-Limonene oxide (mixture of cis and trans) undergoes biocatalytic resolution in the presence of epoxide hydrolase to form enantiomerically pure cis- and trans-limonene oxides. | | Uses | (+)-LIMONENE 1 2-EPOXIDE, a common reagent used in the preparation of fragrant compounds. | | Definition | ChEBI: (4R)-limonene 1,2-epoxide is the (R)-enantiomer of limonene 1,2-epoxide. It derives from a hydride of a (4R)-limonene. | | General Description | Limonene oxide, also known as limonene 1,2-epoxide, is a monoterpene that can be prepared from limonene. It has antinociceptive and antitumoral activities and is used in many products like food additives, cosmetics, and perfumes. |
| | (+)-Limonene 1 2-epoxide Preparation Products And Raw materials |
|