| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
| Company Name: |
Novachemistry |
| Tel: |
44-20819178-90 02081917890 |
| Email: |
info@novachemistry.com |
- 8,9-Epoxy cedrane
-
-
2026-06-30
- CAS:13567-39-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- 8,9-Epoxy cedrane
-
-
2025-06-27
- CAS:13567-39-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- 8,9-Epoxy cedrane
-
-
2020-02-26
- CAS: 13567-39-0
- Min. Order: 100G
- Purity: 99.0%+
- Supply Ability: 100 tons
|
| | 8,9-Epoxy cedrane Basic information |
| Product Name: | 8,9-Epoxy cedrane | | Synonyms: | cedr-8-ene epoxide;8,9-EPOXY CEDRANE;2abeta,3alpha,5aalpha,7beta,7aalpha)]-alph;7-Methanoazuleno[5,6-b]oxirene,octahydro-3,6,6,7a-tetramethyl-,[1aS-(1a.alpha.,2a.beta.,3.alpha.,2H-2a;7-methanoazuleno[5,6-b]oxirene,octahydro-3,6,6,7a-tetramethyl-2h-2[1as-(1a;[1aS-(1aalpha,2abeta,3alpha,5aalpha,7beta,7aalpha)]-octahydro-3,6,6,7a-tetramethyl-2H-2a,7-methanoazuleno[5,6-b]oxirene;Alpha-Cedrene-oxide;2H-2a,7-Methanoazuleno5,6-boxirene, octahydro-3,6,6,7a-tetramethyl-, (1aS,2aR,3R,5aS,7R,7aR)- | | CAS: | 13567-39-0 | | MF: | C15H24O | | MW: | 220.35 | | EINECS: | 236-971-4 | | Product Categories: | Industrial/Fine Chemicals | | Mol File: | 13567-39-0.mol |  |
| | 8,9-Epoxy cedrane Chemical Properties |
| Boiling point | 264.4±8.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | Odor | at 100.00 %. woody amber tobacco sandalwood fresh linalyl acetate patchouli | | Odor Type | woody | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C15H24O/c1-9-5-6-10-13(2,3)11-7-15(9,10)8-12-14(11,4)16-12/h9-12H,5-8H2,1-4H3/t9-,10+,11-,12+,14-,15-/m1/s1 | | InChIKey | HZRFVTRTTXBHSE-RIMRTXSHSA-N | | SMILES | O1[C@]2(C)[C@]3([H])C[C@@]4([C@@]([H])(CC[C@H]4C)C3(C)C)C[C@]12[H] | | LogP | 4.920 | | EPA Substance Registry System | 2H-2a,7-Methanoazuleno[5,6-b]oxirene, octahydro-3,6,6,7a-tetramethyl-, (1aS,2aR,3R,5aS,7R,7aR)- (13567-39-0) |
| | 8,9-Epoxy cedrane Usage And Synthesis |
| Chemical Properties |
Alpha-cedrene epoxide is a colorless viscous liquid. Insoluble in water, soluble in alcohol and perfume oils.
| | Definition | ChEBI: Alpha-Cedrene epoxide is a cedrane sesquiterpenoid. |
| | 8,9-Epoxy cedrane Preparation Products And Raw materials |
|