| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (3-Chlorophenylethynyl)trimethylsilan& Basic information |
| | (3-Chlorophenylethynyl)trimethylsilan& Chemical Properties |
| Boiling point | 240-241 °C (lit.) | | density | 0.995 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.537(lit.) | | Fp | 225 °F | | InChI | 1S/C11H13ClSi/c1-13(2,3)8-7-10-5-4-6-11(12)9-10/h4-6,9H,1-3H3 | | InChIKey | UXVJIDSXBAHIDV-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)C#Cc1cccc(Cl)c1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 |
| | (3-Chlorophenylethynyl)trimethylsilan& Usage And Synthesis |
| | (3-Chlorophenylethynyl)trimethylsilan& Preparation Products And Raw materials |
|