| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N-tert-Butyl-alpha-(2-sulfophenyl)nitro& Basic information |
| Product Name: | N-tert-Butyl-alpha-(2-sulfophenyl)nitro& | | Synonyms: | N-tert-butyl-alpha-(2-sulfophenyl)nitrone;n-tert-butyl-α-(2-sulfophenyl)nitrone sodium salt;2-SPBN sodium salt, 2-Sulfonatophenyl tert-butyl nitrone sodium salt;N-[2-(Sodiooxysulfonyl)benzylidene]-tert-butylamine oxide;N-[2-(Sodiosulfo)benzylidene]-tert-butylamine N-oxide;N-tert-Butyl-2-(sodiosulfo)benzenemethanimine N-oxide;N-tert-Butyl-2-sodiosulfophenylmethanimine N-oxide;N-tert-Butyl-α-(2-sulfophenyl)nitrone sodium salt | | CAS: | 73475-11-3 | | MF: | C11H15NO4S.Na | | MW: | 280.3 | | EINECS: | | | Product Categories: | | | Mol File: | 73475-11-3.mol |  |
| | N-tert-Butyl-alpha-(2-sulfophenyl)nitro& Chemical Properties |
| Melting point | 246 °C (dec.) (lit.) | | storage temp. | room temp | | form | powder or crystals | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C11H15NO4S.Na/c1-11(2,3)12(13)8-9-6-4-5-7-10(9)17(14,15)16;/h4-8H,1-3H3,(H,14,15,16);/q;+1/p-1/b12-8-; | | InChIKey | LAIQBHGUFDAJKL-JCTPKUEWSA-M | | SMILES | [Na+].CC(C)(C)[N+](\[O-])=C\c1ccccc1S([O-])(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N-tert-Butyl-alpha-(2-sulfophenyl)nitro& Usage And Synthesis |
| Uses | Water-soluble, negatively-charged spin trap used to monitor aqueous phase of SDS micelles. |
| | N-tert-Butyl-alpha-(2-sulfophenyl)nitro& Preparation Products And Raw materials |
|