|
|
| | 3,6-DIOXAOCTANEDIOIC ACID Basic information | | Uses |
| Product Name: | 3,6-DIOXAOCTANEDIOIC ACID | | Synonyms: | 3,6-Dioxaoctanedioic acid CAS;3,6-Dioxasuberic acid;Acetic acid, 2,2'-[1,2-ethanediylbis(oxy)]bis- (Triglycolic acid);Acetic acid, 2,2‘-[1,2-ethanediylbis(oxy)]bis-;(2-CARBOXYMETHOXYETHOXY)ACETIC ACID;2,2'-(Ethane-1,2-diylbis(oxy))diacetic acid;3,6-dioxoctanedioic acid;PEG2-(CH2CO2H)2 | | CAS: | 23243-68-7 | | MF: | C6H10O6 | | MW: | 178.14 | | EINECS: | 245-516-9 | | Product Categories: | peg | | Mol File: | 23243-68-7.mol |  |
| | 3,6-DIOXAOCTANEDIOIC ACID Chemical Properties |
| Melting point | 68-71℃ | | Boiling point | 429.2±25.0 °C(Predicted) | | density | 1.375 | | vapor pressure | 0Pa at 20℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 3.09±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C6H10O6/c7-5(8)3-11-1-2-12-4-6(9)10/h1-4H2,(H,7,8)(H,9,10) | | InChIKey | CQWXKASOCUAEOW-UHFFFAOYSA-N | | SMILES | C(OCC(O)=O)COCC(O)=O | | LogP | -2.29 at 25℃ |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-27-22 | | RIDADR | 3261 | | WGK Germany | WGK 1 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2917198090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | 3,6-DIOXAOCTANEDIOIC ACID Usage And Synthesis |
| Uses | 3,6-Dioxaoctanedioic Acid (cas# 23243-68-7) is a useful research chemical. | | Description | PEG2-(CH2CO2H)2 is a PEG linker containing two terminal carboxylic acid groups. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acids can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Uses | 3,6-Dioxaoctanedioic Acid is a useful reagent for the preparation of degradation agents for cyclin dependent kinase. | | Uses | 3,6-Dioxaoctanedioic acid can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. | | Flammability and Explosibility | Not classified | | Synthesis |  To 15 ml (0.33 mol) of nitric acid was added at 45C while stirring 1 g of diethylene glycol from the overall amount of 5.9 g (0.06 mol), and the mixture was heated to 65C. After the end of nitrogen oxides evolution and cooling the mixture to 45-50C another portion of diethylene glycol was added. Overall time of the reagent addition to the reaction mixture was 1 h. The mixture was kept at 45C for 40 min and then it was heated at 80C for 30 min. The solvent was removed in a vacuum at 70C, the residue was dried by azeotropic distillation with benzene using Dean-Stark trap, then the product was fi ltered off and recrystallized from acetone-benzene mixture. 3,6-Dioxaoctanedioic acid (VIII) was similarly obtained. Yield 7.3 g (89%), colorless crystals. Rf 0.20 (E), mp 76-77C (mp 75-76C [13]). IR spectrum, |í, cm-1: 3167 (OH), 2914 (CH), 1733 (C=O acid), 1410, 1229 (C-O), 1121 (C-O). Mass spectrum, m/z (Irel, %): 178.5 [M]+ (76), 200.9 (55), 216.8 (46). | | IC 50 | PEGs | | References | [1] Patent: CN105669707, 2016, A. Location in patent: Paragraph 0018; 0019 |
| | 3,6-DIOXAOCTANEDIOIC ACID Preparation Products And Raw materials |
|