|
|
| | Mmt-hexylamine-linker amidite 0.15g, ab, Basic information |
| Product Name: | Mmt-hexylamine-linker amidite 0.15g, ab, | | Synonyms: | MMT-Hexylamine-Linker Amidite 0.25g, AB,;MMT-HEXYLAMINE-LINKER AMIDITE 0.25G 89;MMT-Hexylamine-Linker Amidite 0.15g, 89,;MMT-Hexylaminolinker Phosphoramidite;MMT amine-linker Phosphoramidite;Monomethoxytrityl-hexylamine-linker
Phosphoramidite;Phosphoramidous acid, N,N-bis(1-methylethyl)-, 2-cyanoethyl 6-[[(4-methoxyphenyl)diphenylmethyl]amino]hexyl ester;6-(4-Monomethoxytritylamino)hexyl-(2-cyanoethyl)-(N,N-diisopropyl)-phosphoramidite | | CAS: | 114616-27-2 | | MF: | C35H48N3O3P | | MW: | 589.75 | | EINECS: | | | Product Categories: | Amidite | | Mol File: | 114616-27-2.mol |  |
| | Mmt-hexylamine-linker amidite 0.15g, ab, Chemical Properties |
| Boiling point | 634.0±55.0 °C(Predicted) | | storage temp. | -20°C | | form | Viscous Liquid | | pka | 8.17±0.38(Predicted) | | color | Colorless to light yellow | | InChIKey | YBANXOPIYSVPMH-UHFFFAOYSA-N | | SMILES | P(N(C(C)C)C(C)C)(OCCCCCCNC(C1=CC=C(OC)C=C1)(C1=CC=CC=C1)C1=CC=CC=C1)OCCC#N |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Mmt-hexylamine-linker amidite 0.15g, ab, Usage And Synthesis |
| Uses | N,N-Bis(1-methylethyl)phosphoramidous Acid 2-Cyanoethyl 6-[[(4-Methoxyphenyl)diphenylmethyl]amino]hexyl Ester can be used to prepare branched compounds for use in nucleic acid detection and analysis reactions as well as synthesis. |
| | Mmt-hexylamine-linker amidite 0.15g, ab, Preparation Products And Raw materials |
|