5'-Amino-modifier-C 6-TFA CEP manufacturers
|
| | 5'-Amino-modifier-C 6-TFA CEP Basic information |
| Product Name: | 5'-Amino-modifier-C 6-TFA CEP | | Synonyms: | C6 TFA LINKER AMIDITE;BIS(1-METHYLETHYL)PHOSPHORAMIDOUS ACID 2-CYANOETHYL 6-((TRIFLUOROACETYL)AMINO)HEXYL ESTER;trifluoroacetyl cyanoethyl phosphoramidite amino-linker;TFA-C6-amine-linker Phosphoramidite;Trifluoroacetyl-hexylamine-linker Phosphoramidite;2-cyanoethyl 6-(2,2,2-trifluoroacetamido)hexyl diisopropylphosphoramidite;5'-Amino-Modifier C6-TFA CE Phosphoramidite;N,N-Bis(1-methylethyl)phosphoramidous acid 2-cyanoethyl [6-[(2,2,2-trifluoroacetyl)amino]hexyl] ester | | CAS: | 133975-85-6 | | MF: | C17H31F3N3O3P | | MW: | 413.42 | | EINECS: | | | Product Categories: | | | Mol File: | 133975-85-6.mol |  |
| | 5'-Amino-modifier-C 6-TFA CEP Chemical Properties |
| Boiling point | 433.7±45.0 °C(Predicted) | | bulk density | 1.095g/mL | | storage temp. | -70°C | | pka | 11.42±0.46(Predicted) | | InChI | InChI=1S/C17H31F3N3O3P/c1-14(2)23(15(3)4)27(26-13-9-10-21)25-12-8-6-5-7-11-22-16(24)17(18,19)20/h14-15H,5-9,11-13H2,1-4H3,(H,22,24) | | InChIKey | SMMKTKILBQHSFL-UHFFFAOYSA-N | | SMILES | P(N(C(C)C)C(C)C)(OCCCCCCNC(C(F)(F)F)=O)OCCC#N |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5'-Amino-modifier-C 6-TFA CEP Usage And Synthesis |
| | 5'-Amino-modifier-C 6-TFA CEP Preparation Products And Raw materials |
|