| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | BIS-(TOLUENE-4-SULFONYL)-METHANE Basic information |
| Product Name: | BIS-(TOLUENE-4-SULFONYL)-METHANE | | Synonyms: | bis(4-methylphenylsulfonyl)methane;Bis(p-toluenesulfonyl)methane, 97%;BIS-(TOLUENE-4-SULFONYL)-METHANE;1-methyl-4-[(4-methylphenyl)sulfonylmethylsulfonyl]benzene;Benzene, 1,1'-[methylenebis(sulfonyl)]bis[4-methyl-;Ditosylmethane | | CAS: | 15310-28-8 | | MF: | C15H16O4S2 | | MW: | 324.42 | | EINECS: | | | Product Categories: | | | Mol File: | 15310-28-8.mol |  |
| | BIS-(TOLUENE-4-SULFONYL)-METHANE Chemical Properties |
| Melting point | 137-139℃ | | Boiling point | 557.6±50.0 °C(Predicted) | | density | 1.298±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C15H16O4S2/c1-12-3-7-14(8-4-12)20(16,17)11-21(18,19)15-9-5-13(2)6-10-15/h3-10H,11H2,1-2H3 | | InChIKey | XLOXYWLRAKCDQL-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(C[S](=O)(=O)c2ccc(cc2)C)c1ccc(cc1)C |
| Hazard Codes | Xi | | Risk Statements | 36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | BIS-(TOLUENE-4-SULFONYL)-METHANE Usage And Synthesis |
| | BIS-(TOLUENE-4-SULFONYL)-METHANE Preparation Products And Raw materials |
|