| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | Bis(triphenylsilyl)chromate 96 Basic information |
| | Bis(triphenylsilyl)chromate 96 Chemical Properties |
| Melting point | 159 °C (dec.) (lit.) | | InChI | InChI=1S/2C18H15OSi.Cr.2O/c2*19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;;;/q2*-1;+2;; | | InChIKey | AQLZCGLPNYEIDH-UHFFFAOYSA-N | | SMILES | [Si](O[Cr](=O)(=O)O[Si](C1=CC=CC=C1)(C1C=CC=CC=1)C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)C1C=CC=CC=1 | | EPA Substance Registry System | Chromic acid (H2CrO4), bis(triphenylsilyl) ester (1624-02-8) |
| Hazard Codes | T,N | | Risk Statements | 49-43-50/53 | | Safety Statements | 53-45-60-61 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 2 | | RTECS | GB2685000 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Carc. 1B
Skin Sens. 1 |
| | Bis(triphenylsilyl)chromate 96 Usage And Synthesis |
| Uses | Reactant for the XPS and XRD characterization of chromium-silica catalysts
Silyl chromate catalyst for
- Olefin polymerization and ethylene polymerization
- Benzylic oxidations used as a phase transfer catalyst
| | Hazard | Moderately toxic by ingestion and skin
contact. | | reaction suitability | reagent type: oxidant |
| | Bis(triphenylsilyl)chromate 96 Preparation Products And Raw materials |
|