|
|
| | D-2-AMINO-2-PHENYLACETAMIDE Basic information |
| Product Name: | D-2-AMINO-2-PHENYLACETAMIDE | | Synonyms: | (R)-phenylglycine amide hydrochloride;D(-)-Phenylglycinamide hydrochloride;D-2-AMINO-2-PHENYLACETAMIDE;D(-)-Phenylglycinamide hydrochloride,97%;D-2-Amino-2-phenylacetamide hydrochloride 97%;(R)-(-)-2-Aminophenylacetamide hydrochloride;D-Phenylglycine amide hydrochloride≥ 99% (TLC);(2R)-2-aMino-2-phenylethanaMide hydrochloride | | CAS: | 63291-39-4 | | MF: | C8H10N2O.ClH | | MW: | 186.64 | | EINECS: | | | Product Categories: | | | Mol File: | 63291-39-4.mol |  |
| | D-2-AMINO-2-PHENYLACETAMIDE Chemical Properties |
| Melting point | 294 °C (dec.)(lit.) | | storage temp. | Store at 0°C | | Optical Rotation | [α]20/D -1.4°, c =1% in H2O | | Major Application | peptide synthesis | | InChI | 1S/C8H10N2O.ClH/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5,7H,9H2,(H2,10,11);1H/t7-;/m1./s1 | | InChIKey | LXOAFHGMXCFTOU-OGFXRTJISA-N | | SMILES | Cl.N[C@@H](C(N)=O)c1ccccc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | D-2-AMINO-2-PHENYLACETAMIDE Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis |
| | D-2-AMINO-2-PHENYLACETAMIDE Preparation Products And Raw materials |
|