|
|
| | GSK3145095 Basic information |
| Product Name: | GSK3145095 | | Synonyms: | GSK3145095;RIPK1 inhibitor GS3145095;1H-1,2,4-Triazole-5-carboxamide, N-[(3S)-7,9-difluoro-2,3,4,5-tetrahydro-2-oxo-1H-1-benzazepin-3-yl]-3-(phenylmethyl)-;Inhibitor,GSK3145095,inhibit,RIP kinase,GSK-3145095,Receptor-interacting protein kinases,RIPK,GSK 3145095;(S)-5-Benzyl-N-(7,9-difluoro-2-oxo-2,3,4,5-tetrahydro-1H-benzo[b]azepin-3-yl)-4H-1,2,4-triazole-3-carboxamide;GSK3145095, 10 mM in DMSO | | CAS: | 1622849-43-7 | | MF: | C20H17F2N5O2 | | MW: | 397.38 | | EINECS: | | | Product Categories: | | | Mol File: | 1622849-43-7.mol |  |
| | GSK3145095 Chemical Properties |
| density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:164.5(Max Conc. mg/mL);413.96(Max Conc. mM)
Ethanol:6.0(Max Conc. mg/mL);15.1(Max Conc. mM) | | form | Solid | | pka | 8.82±0.40(Predicted) | | color | White to off-white | | InChIKey | ATQAGKAMBISZQM-HNNXBMFYSA-N | | SMILES | N1C(C(N[C@H]2CCC3=CC(F)=CC(F)=C3NC2=O)=O)=NC(CC2=CC=CC=C2)=N1 |
| | GSK3145095 Usage And Synthesis |
| Uses | GSK3145095 is a RIP1 kinase inhibitor with an IC50 of 6.3 nM [1]. | | References | [1] Harris PA, ET AL. Identification of a RIP1 Kinase Inhibitor Clinical Candidate (GSK3145095) for the Treatment of Pancreatic Cancer. ACS Med Chem Lett. 2019 May 9;10(6):857-862. DOI:10.1021/acsmedchemlett.9b00108 |
| | GSK3145095 Preparation Products And Raw materials |
|