- GSK-3008348
-
- $397.00
-
2026-07-27
- CAS:1629249-33-7
- Purity: 99.54%
- Supply Ability: 10g
- GSK3008348
-
- $1.00
-
2019-12-26
- CAS:1629249-33-7
- Min. Order: 1KG
- Purity: 97%-99.9%
- Supply Ability: 100kg
|
| | GSK3008348 Basic information |
| Product Name: | GSK3008348 | | Synonyms: | GSK3008348;GSK 3008348;GSK-3008348;1-Pyrrolidinebutanoic acid, β-[3-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-, (βS,3R)-;1-Pyrrolidinebutanoicacid,β-[3-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]-3-[2-(1,5,6,7-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-,(βS,3R)-;(S)-3-(3-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl)-4-((R)-3-(2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl)pyrrolidin-1-yl)butanoic acid;CAS:1629249-33-7 | | CAS: | 1629249-33-7 | | MF: | C29H37N5O2 | | MW: | 487.65 | | EINECS: | | | Product Categories: | | | Mol File: | 1629249-33-7.mol |  |
| | GSK3008348 Chemical Properties |
| Boiling point | 716.2±60.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | pka | 4.22±0.10(Predicted) | | form | Solid | | color | Brown to orange | | InChIKey | ZMXBIIQMSGOIRZ-YYYSDWHGNA-N | | SMILES | CC1=CC(C)=NN1C1C=CC=C([C@H](CC(=O)O)CN2CC[C@@H](CCC3=CC=C4CCCN=C4N3)C2)C=1 |&1:12,21,r| |
| | GSK3008348 Usage And Synthesis |
| Uses | GSK3008348 (CAS# 1629249-33-7) is a pharmaceutically acceptable salt thereof for use in combination therapy of interstitial lung disease. |
| | GSK3008348 Preparation Products And Raw materials |
|