| Company Name: |
Henan's chemical products co., LTD
|
| Tel: |
0371-60919097 15378766539; |
| Email: |
794449696@qq.com |
| Products Intro: |
Product Name:1,10-Phenanthroline, 3-[4-(1,2,2-triphenylethenyl)phenyl]- CAS:1486512-62-2 Purity:0.98 Package:5g,10g,25g,50g,100g
|
|
| | 1,10-Phenanthroline, 3-[4-(1,2,2-triphenylethenyl)phenyl]- Basic information |
| Product Name: | 1,10-Phenanthroline, 3-[4-(1,2,2-triphenylethenyl)phenyl]- | | Synonyms: | 1,?10-?Phenanthroline, 3-?[4-?(1,?2,?2-?triphenylethenyl)?phenyl]?-;3-(4-(1,2,2-Triphenylvinyl)phenyl)-1,10-phenanthroline | | CAS: | 1486512-62-2 | | MF: | C38H26N2 | | MW: | 510.63 | | EINECS: | | | Product Categories: | | | Mol File: | 1486512-62-2.mol | ![1,10-Phenanthroline, 3-[4-(1,2,2-triphenylethenyl)phenyl]- Structure](CAS/20210305/GIF/1486512-62-2.gif) |
| | 1,10-Phenanthroline, 3-[4-(1,2,2-triphenylethenyl)phenyl]- Chemical Properties |
| Boiling point | 653.7±43.0 °C(Predicted) | | density | 1.200±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.62±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C38H26N2/c1-4-11-28(12-5-1)35(29-13-6-2-7-14-29)36(30-15-8-3-9-16-30)31-20-18-27(19-21-31)34-25-33-23-22-32-17-10-24-39-37(32)38(33)40-26-34/h1-26H | | InChIKey | BNDJPEALBWNQFN-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=CC=C3)C=C(C2=CC=C(/C(/C3=CC=CC=C3)=C(\C3=CC=CC=C3)/C3=CC=CC=C3)C=C2)C=1 |
| | 1,10-Phenanthroline, 3-[4-(1,2,2-triphenylethenyl)phenyl]- Usage And Synthesis |
| | 1,10-Phenanthroline, 3-[4-(1,2,2-triphenylethenyl)phenyl]- Preparation Products And Raw materials |
|