| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Chemsoon Co., Ltd |
| Tel: |
021-51987688-803 18916626396 |
| Email: |
info@chemsoon.com |
|
| | tetra-(4-pyridylphenyl)ethylene Basic information |
| Product Name: | tetra-(4-pyridylphenyl)ethylene | | Synonyms: | tetra-(4-pyridylphenyl)ethylene;Tetrakis(4-pyridylphenyl)ethylene;Tetrakis[4-(4-phenylphenyl)pyridine]ethylene;Pyridine, 4,4',4'',4'''-(1,2-ethenediylidenetetra-4,1-phenylene)tetrakis-;Pyridine, 4,4',4'',4'''-(1,2-ethenediylide;4,4',4'',4'''-(1,1,2,2-Ethenetetrayltetra-4,1-phenylene)tetrapyridine;etrakis(4-pyridylphenyl)ethylene;TPE42 | | CAS: | 1227195-24-5 | | MF: | C46H32N4 | | MW: | 640.77 | | EINECS: | | | Product Categories: | MOF | | Mol File: | 1227195-24-5.mol |  |
| | tetra-(4-pyridylphenyl)ethylene Chemical Properties |
| Boiling point | 780.9±60.0 °C(Predicted) | | density | 1.187±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 6.20±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChIKey | DXNBXIFFCPRQAI-UHFFFAOYSA-N | | SMILES | C(/C1=CC=C(C2C=CN=CC=2)C=C1)(\C1=CC=C(C2C=CN=CC=2)C=C1)=C(\C1=CC=C(C2C=CN=CC=2)C=C1)/C1=CC=C(C2C=CN=CC=2)C=C1 |
| | tetra-(4-pyridylphenyl)ethylene Usage And Synthesis |
| Uses | Tetra-(4-pyridylphenyl)ethylene can be used as ligands in the synthesis of MOF materials: LMOF-241; LMOF-271; LMOF-261/262/263. |
| | tetra-(4-pyridylphenyl)ethylene Preparation Products And Raw materials |
|