Bis-peg13-nhs ester manufacturers
- Bis-PEG13-NHS ester
-
-
2025-06-07
- CAS:2221949-00-2
- Min. Order: 1g
- Purity: >95.00%
- Supply Ability: 1g
|
| | Bis-peg13-nhs ester Basic information |
| Product Name: | Bis-peg13-nhs ester | | Synonyms: | 4,7,10,13,16,19,22,25,28,31,34,37,40-Tridecaoxatritetracontanedioic acid, 1,43-bis(2,5-dioxo-1-pyrrolidinyl) ester;Bis-dPEG13-NHS ester;Di-NHS Ester-PEG13;Bis(2,5-dioxopyrrolidin-1-yl) 4,7,10,13,16,19,22,25,28,31,34,37,40-tridecaoxatritetracontanedioate;Bis(2,5-dioxo-1-pyrrolidinyl) 4,7,10,13,16,19,22,25,28,31,34,37,40-Tridecaoxatritetracontane-1,43-dioate;COONHS-PEG13-CH2CH2COONHS;NHSOOCCH2CH2O-PEG12-CH2CH2COONHS ester;NHS-PEG13-NHS | | CAS: | 2221949-00-2 | | MF: | C38H64N2O21 | | MW: | 884.92 | | EINECS: | | | Product Categories: | | | Mol File: | 2221949-00-2.mol |  |
| | Bis-peg13-nhs ester Chemical Properties |
| Boiling point | 833.0±75.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | -20°C, sealed storage, away from moisture | | form | Solid-Liquid Mixture | | color | Colorless to off-white | | InChIKey | OVDFFVRBNAHLOH-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(ON1C(=O)CCC1=O)=O |
| | Bis-peg13-nhs ester Usage And Synthesis |
| Uses | Bis-PEG13-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Bis-PEG13-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. | | IC 50 | PEGs; Alkyl/ether; Cleavable Linker | | References | [1] John L. Magnani, et al. Highly potent multimeric e-selectin antagonists. WO2018068010A1 |
| | Bis-peg13-nhs ester Preparation Products And Raw materials |
|