|
|
| | Flamprop-isopropyl Basic information |
| | Flamprop-isopropyl Chemical Properties |
| Melting point | 56.5°C | | Boiling point | 476.4±45.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | Fp | >100 °C | | pka | -1.02±0.50(Predicted) | | Water Solubility | 18mg/L(20 ºC) | | Major Application | agriculture
environmental | | InChI | 1S/C19H19ClFNO3/c1-12(2)25-19(24)13(3)22(15-9-10-17(21)16(20)11-15)18(23)14-7-5-4-6-8-14/h4-13H,1-3H3/t13-/m0/s1 | | InChIKey | IKVXBIIHQGXQRQ-ZDUSSCGKSA-N | | SMILES | CC(C)OC(=O)[C@H](C)N(C(=O)c1ccccc1)c2ccc(F)c(Cl)c2 | | EPA Substance Registry System | Flamprop-isopropyl (52756-22-6) |
| WGK Germany | 2 | | RTECS | AY3274700 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2 |
| | Flamprop-isopropyl Usage And Synthesis |
| Uses | Flamprop-isopropyl acts as a pesticide. | | Mechanism of action | Selective, systemic, absorbed by leaves | | Synthesis | To a 25 mL oven-dried flask containing isopropyl 2-(3-chloro-4-fluorophenylamino) propionate (78 mg, 0.3 mmol) was added 5 mL of CH2Cl2 under nitrogen atmosphere. benzoyl chloride (51 mg, 0.36 mmol) was added dropwise and stirred for 20 min. Triethylamine (31 mg, 0.3 mmol) was slowly added to the flask and stirred at room temperature for 8 hours. An additional 51 mg of benzoyl chloride and 31 mg of triethylamine were added to the flask and stirred for 24 hours. The resulting mixture was purified by chromatography to give (R)-flavan-M-isopropyl. Yield 104 mg, 95%, colorless oil. | | Pesticide Type | Herbicide |
| | Flamprop-isopropyl Preparation Products And Raw materials |
|