|
|
| | 6-PHTHALIMIDO-1-HEXYNE Basic information |
| Product Name: | 6-PHTHALIMIDO-1-HEXYNE | | Synonyms: | TIMTEC-BB SBB008977;N-HEX-5-YNYLPHTHALIMIDE;N-(5-HEXYNYL)PHTHALIMIDE;6-PHTHALIMIDO-1-HEXYNE;6-Phthalimido-1-hexyne, N-Hex-5-ynylphthalimide;N-(5-Hexynyl)phthalimide >=95%;2-(hex-5-ynyl)isoindoline-1,3-dione;N-(5-HEXYNYL)PHTHALIMIDE, 97%N-(5-HEXYNYL)PHTHALIMIDE, 97%N-(5-HEXYNYL)PHTHALIMIDE, 97%N-(5-HEXYNYL)PHTHALIMIDE, 97% | | CAS: | 6097-08-1 | | MF: | C14H13NO2 | | MW: | 227.26 | | EINECS: | | | Product Categories: | | | Mol File: | 6097-08-1.mol |  |
| | 6-PHTHALIMIDO-1-HEXYNE Chemical Properties |
| Melting point | 68-72 °C(lit.) | | Boiling point | 360.2±25.0 °C(Predicted) | | density | 1.196±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | -2.14±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C14H13NO2/c1-2-3-4-7-10-15-13(16)11-8-5-6-9-12(11)14(15)17/h1,5-6,8-9H,3-4,7,10H2 | | InChIKey | WALVSJIWVWDFCU-UHFFFAOYSA-N | | SMILES | O=C1N(CCCCC#C)C(=O)c2ccccc12 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 6-PHTHALIMIDO-1-HEXYNE Usage And Synthesis |
| Uses | 6-amino-1-hexyne was prepared from N-(5-Hexynyl)phthalimide which is the starting material. Used in the synthesis of Amino-alkyne. | | Uses | Reactant for:
- TBAF-catalyzed monoreduction
- Ruthenium-catalyzed hydrative conjugative addition to alkenes
- Regioselective nickel-catalyzed carbocyanation reactions
- Zinc-catalyzed intermolecular hydroaminations
- Copper catalyzed cycloaddition with azides
| | General Description | N-(5-Hexynyl)phthalimide is an N-alkyl substituted phthalimide derivative. |
| | 6-PHTHALIMIDO-1-HEXYNE Preparation Products And Raw materials |
|