Allyl 2,2,3,3,4,4,5,5-octafluoropentyl ether manufacturers
|
| | Allyl 2,2,3,3,4,4,5,5-octafluoropentyl ether Basic information |
| Product Name: | Allyl 2,2,3,3,4,4,5,5-octafluoropentyl ether | | Synonyms: | 2,2,3,3,4,4,5,5-OCTAFLUORO-6-OXA-8-NONENE;Allyl 1H,1H,5H-octafluoropentyl ether;Allyl 2,2,3,3,4,4,5,5-octafluoropentyl ether 97+%;Pentane, 1,1,2,2,3,3,4,4-octafluoro-5-(2-propen-1-yloxy)-;Allyl 2,2,3,3,4,4,5,5-octafluoropentyl ether | | CAS: | 3108-07-4 | | MF: | C8H8F8O | | MW: | 272.14 | | EINECS: | | | Product Categories: | | | Mol File: | 3108-07-4.mol |  |
| | Allyl 2,2,3,3,4,4,5,5-octafluoropentyl ether Chemical Properties |
| Boiling point | 126-127 °C(Press: 20 Torr) | | density | 1.4318 g/cm³ | | form | liquid | | color | Clear | | InChI | InChI=1S/C8H8F8O/c1-2-3-17-4-6(11,12)8(15,16)7(13,14)5(9)10/h2,5H,1,3-4H2 | | InChIKey | HIXXYZPZBSOJHD-UHFFFAOYSA-N | | SMILES | C(F)(F)C(F)(F)C(F)(F)C(F)(F)COCC=C |
| Hazard Codes | Xi | | Safety Statements | 23-24/25 | | HazardClass | IRRITANT | | HS Code | 2910900090 |
| | Allyl 2,2,3,3,4,4,5,5-octafluoropentyl ether Usage And Synthesis |
| | Allyl 2,2,3,3,4,4,5,5-octafluoropentyl ether Preparation Products And Raw materials |
|