|
|
| | 1H,1H,5H-Octafluoropentyl Acrylate Basic information |
| Product Name: | 1H,1H,5H-Octafluoropentyl Acrylate | | Synonyms: | 1H,1H,5H-Octafluoropentyl;Propenoic acid 2,2,3,3,4,4,5,5-octafluoropentyl ester;Octafluoropentyl acrylate;OFPA;1H,1H,5H-Octafluoropentyl Acrylate ;1H,1H,5H-Octafluoropentyl Acrylate (stabilized with MEHQ);2,2,3,3,4,4,5,5-Octafluoropentyl acrylate, stabilized with &ap:50ppm 4-methoxyphenol;DAIKIN R-5410 | | CAS: | 376-84-1 | | MF: | C8H6F8O2 | | MW: | 286.12 | | EINECS: | 206-816-5 | | Product Categories: | Monomers;monomer;Fluorous Chemistry;Fluorous Compounds;Synthetic Organic Chemistry;Acrylic Monomers;Fluorinated AcrylicsSelf Assembly&Contact Printing;Fluorine-Containing Monomers for 157 nm UV Lithography Resist Polymers;Lithography Monomers | | Mol File: | 376-84-1.mol |  |
| | 1H,1H,5H-Octafluoropentyl Acrylate Chemical Properties |
| Boiling point | 122 °C/140 mmHg (lit.) | | density | 1.488 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.349(lit.) | | RTECS | UD3643645 | | Fp | 161 °F | | storage temp. | 2-8°C | | Water Solubility | Practically insoluble in water | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.481 | | InChI | InChI=1S/C8H6F8O2/c1-2-4(17)18-3-6(11,12)8(15,16)7(13,14)5(9)10/h2,5H,1,3H2 | | InChIKey | WISUNKZXQSKYMR-UHFFFAOYSA-N | | SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)(=O)C=C | | CAS DataBase Reference | 376-84-1(CAS DataBase Reference) | | NIST Chemistry Reference | 1h,1h,5h-Octafluoropentyl acrylate(376-84-1) | | EPA Substance Registry System | 2-Propenoic acid, 2,2,3,3,4,4,5,5-octafluoropentyl ester (376-84-1) |
| Hazard Codes | Xi,N,F | | Risk Statements | 36/37/38-51/53 | | Safety Statements | 26-28-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | Hazard Note | Flammable/Keep Cold | | HazardClass | KEEP COLD, FLAMMABLE | | HS Code | 29161290 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1H,1H,5H-Octafluoropentyl Acrylate Usage And Synthesis |
| Uses | 1H,1H,5H-octafluoropentyl acrylate (OFPA) belongs to fluorinated acrylates having different fluoroalkyl chains. Two Y-shaped molecules, combining two dissimilar (hydrophilic and hydrophobic) units with a reactive triethoxysilane moiety, were synthesized by Koizumi et al. The synthesis involved a Michael addition reaction of (aminopropyl)triethoxysilane with 2-hydroxyethyl acrylate (HEA), followed by the addition of either 2,2,2-trifluoroethyl acrylate (TFEA) or 1H,1H,5H-octafluoropentyl acrylate (OFPA)[1].
| | References | [1] Ryo Koizumi . “Amphiphilic silsesquioxane nanoparticles by hydrolytic condensation of Y-shaped triethoxysilanes having hydroxyl and fluoroalkyl groups: Synthesis, self-assembly, and surface properties.” Polymer 110 (2017): Pages 260-272. |
| | 1H,1H,5H-Octafluoropentyl Acrylate Preparation Products And Raw materials |
| Raw materials | Chlorosulfurous acid, 2,2,3,3,4,4,5,5-octafluoropentyl ester-->2,2,3,3,4,4,5,5-Octafluoro-1-pentanol-->POTASSIUM ACRYLATE-->Acrylic acid |
|