|
|
| | 1H,1H,5H-OCTAFLUOROPENTYL METHACRYLATE Basic information | | Application |
| Product Name: | 1H,1H,5H-OCTAFLUOROPENTYL METHACRYLATE | | Synonyms: | 2,2,3,3,4,4,5,5-Octafluoropentyl 2-methylacrylate;2-Propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester;1H,1H,5H-PERFLUOROPENTYL METHACRYLATE;1H,1H,5H-OCTAFLUOROPENTYL METHACRYLATE;2,2,3,3,4,4,5,5-OCTAFLUOROPENTYL METHACRYLATE;2,2,3,3,4,4,5,5-Octafluoropentyl methacrylate, 98%, stab. with 50ppm 4-methoxyphenol;1H,1H,5H-Octafluoropentyl Methacrylate (stabilized with TBC);DAIKIN M-5410 | | CAS: | 355-93-1 | | MF: | C9H8F8O2 | | MW: | 300.15 | | EINECS: | 206-596-0 | | Product Categories: | Fluorinated AcrylicsSelf Assembly&Contact Printing;Fluorine-Containing Monomers for 157 nm UV Lithography Resist Polymers;Lithography Monomers;Acrylic Monomers;Monomers;monomer | | Mol File: | 355-93-1.mol |  |
| | 1H,1H,5H-OCTAFLUOROPENTYL METHACRYLATE Chemical Properties |
| Melting point | 8-12°C | | Boiling point | 88 °C/40 mmHg (lit.) | | density | 1.432 g/mL at 25 °C (lit.) | | vapor pressure | 12.41hPa at 25.5℃ | | refractive index | n20/D 1.358(lit.) | | Fp | 178 °F | | storage temp. | Keep Cold | | form | clear liquid | | Specific Gravity | 1.50 | | color | Colorless to Almost colorless | | Water Solubility | 30mg/L at 20℃ | | BRN | 1801409 | | Cosmetics Ingredients Functions | BINDING | | InChI | 1S/C9H8F8O2/c1-4(2)5(18)19-3-7(12,13)9(16,17)8(14,15)6(10)11/h6H,1,3H2,2H3 | | InChIKey | ZNJXRXXJPIFFAO-UHFFFAOYSA-N | | SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F | | LogP | 3.03 at 35℃ | | CAS DataBase Reference | 355-93-1(CAS DataBase Reference) | | NIST Chemistry Reference | 1h,1h,5h-Octafluoropentyl methacrylate(355-93-1) | | EPA Substance Registry System | 1H,1H,5H-Perfluoropentyl methacrylate (355-93-1) |
| Hazard Codes | Xi,F | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Flammable/Keep Cold | | HazardClass | KEEP COLD, FLAMMABLE | | HS Code | 29161400 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1H,1H,5H-OCTAFLUOROPENTYL METHACRYLATE Usage And Synthesis |
| Application | Recently, it has been widely used in coatings for wear resistance, weather resistance, chemical resistance, water resistance, and oil resistance, as well as in plastic lenses, heat-resistant shape memory materials, anti-reflective films, surface treatment coatings for silicone medical devices, fiber treatment agents, optical fiber materials, dental materials, etc. | | Flammability and Explosibility | Not classified |
| | 1H,1H,5H-OCTAFLUOROPENTYL METHACRYLATE Preparation Products And Raw materials |
|