| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- chloramine B
-
-
2026-10-29
- CAS:127-52-6
- Min. Order: 1T
- Purity: 995
- Supply Ability: 5000mt
|
| | Chloramine B Basic information |
| | Chloramine B Chemical Properties |
| Melting point | 190°C | | Boiling point | 189℃[at 101 325 Pa] | | density | 1.484[at 20℃] | | vapor pressure | 0Pa at 20℃ | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | H2O: 0.1 g/mL, clear | | form | solid | | pka | 1.88[at 20 ℃] | | Appearance | White to off-white Solid | | Water Solubility | 0.1 g/mL | | Merck | 14,2074 | | BRN | 3599287 | | InChI | InChI=1S/C6H5ClNO2S.Na/c7-8-11(9,10)6-4-2-1-3-5-6;/h1-5H;/q-1;+1 | | InChIKey | KDNCILYKSYKEFJ-UHFFFAOYSA-N | | SMILES | C1(=CC=CC=C1)S(=O)(=O)N(Cl)[Na] | | LogP | 0.14 at 26℃ | | EPA Substance Registry System | Chloramine B (127-52-6) |
| Hazard Codes | C | | Risk Statements | 22-31-34-42-2 | | Safety Statements | 7-22-26-36/37/39-45 | | RIDADR | UN 3263 8/PG 2 | | WGK Germany | 3 | | RTECS | DA9300000 | | TSCA | TSCA listed | | HazardClass | 5.1 | | PackingGroup | III | | HS Code | 29350090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Resp. Sens. 1
Skin Corr. 1B | | Hazardous Substances Data | 127-52-6(Hazardous Substances Data) |
| | Chloramine B Usage And Synthesis |
| Uses | Used in investigations of the toxicity response of electroactive microbial biofilms
Catalyst for rearrangement of aziridinofullerenes to azafulleroids
Oxidizing agent for polymerization of thiophenol, synthesis of o-aminobenzenesulfonic acids and ciproflaxin
Decontaminant for mustard | | Uses |
Chloramine B's a organochlorine disinfectant, and the effective chloric arrive 26-28%, the property is stable, only loss 0.1% effective chloric after airtight kept 1 year . Slightly soluble in water, and Stimulating & corrosive is small, so the efficacy is slower than hypochlorous acid. Chloramine-B is mainly used for disinfecting container of drinking water, all kind of tableware, fruits and vegetables(5ppm), aquaculture water and enamel instruments(1%). It's also can be used for cleaning breast of cattle, milk cup, livestock urinary tract, festering,etc.
| | Hazard | Chloramine B is a corrosive and irritating substance that is harmful to human health. It is safe when used strictly in accordance with the dilution ratio. Excessive use or accidental ingestion can pose significant health risks. Exposure to high concentrations of this product may cause damage to the skin, eyes, and respiratory tract; prolonged exposure may lead to respiratory sensitization and induce methemoglobinemia. Inhalation may cause severe coughing, sore throat, chest tightness, and difficulty breathing. Accidental ingestion may result in severe abdominal pain, nausea, and vomiting. | | Flammability and Explosibility | Non flammable | | reaction suitability | reagent type: oxidant |
| | Chloramine B Preparation Products And Raw materials |
|