| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:17?-Estradiol-d5
CAS:221093-45-4
Remarks:CS-C-01420
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:17beta-Estradiol-D5 solution
CAS:221093-45-4
Purity:100 mug/mL in acetonitrile, ampule of 1 mL, certified refere Package:1ML Remarks:E-061-1ML
|
17BETA-ESTRADIOL-2,4,16,16,17-D5 manufacturers
|
| | 17BETA-ESTRADIOL-2,4,16,16,17-D5 Basic information |
| Product Name: | 17BETA-ESTRADIOL-2,4,16,16,17-D5 | | Synonyms: | 17β-Estradiol-2,4,16,16,17-D5;17BETA-ESTRADIOL-2,4,16,16,17-D5;17β-Estradiol-D5 solution;2,4,16,16,17-2H-estradiol-17β;[2H5]-17-beta-Estradiol;(8R,9S,13S,14S,17S)-2,4,16,16,17-pentadeuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-diol;17beta-Estradiol-D5 solution;17β-Estradiol-2?4?16?16?17-[d5] | | CAS: | 221093-45-4 | | MF: | C18H19D5O2 | | MW: | 277.41 | | EINECS: | 690-579-1 | | Product Categories: | Steroids & Hormones - 13C & 2H;Alphabetical Listings;E-FStable Isotopes;Labeled Bioactive Compounds;Metabolic Research;OtherStable Isotopes;Stable Isotopes;Steroids | | Mol File: | 221093-45-4.mol |  |
| | 17BETA-ESTRADIOL-2,4,16,16,17-D5 Chemical Properties |
| Melting point | 178-179 °C(lit.) | | Fp | 2℃ | | storage temp. | -20°C | | solubility | Methanol (Slightly) | | form | Solid | | color | White | | Major Application | clinical testing
clinical testing | | InChI | 1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1/i3D,7D2,10D,17D | | InChIKey | VOXZDWNPVJITMN-MOKSCAJFSA-N | | SMILES | [2H]c1cc2[C@H]3CC[C@@]4(C)[C@@H](CC([2H])([2H])[C@]4([2H])O)[C@@H]3CCc2c([2H])c1O |
| Hazard Codes | T,Xn,F | | Risk Statements | 45-36-20/21/22-11 | | Safety Statements | 53-45-36/37-16 | | RIDADR | UN 1648 3 / PGII | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | 17BETA-ESTRADIOL-2,4,16,16,17-D5 Usage And Synthesis |
| Uses | clinical testing
clinical testing | | General Description | A stable-labeled internal standard for 17-Estradiol testing or isotope dilution methods by GC/MS or LC/MS for endocrinology, clinical chemistry or diagnostic purposes. Estradiol is a sex hormone prescribed under the trade names Vagifem, Estring, Evamist, Elestrin, Estrace, and Estrogel as a treatment for hypoestrogenism. |
| | 17BETA-ESTRADIOL-2,4,16,16,17-D5 Preparation Products And Raw materials |
|