| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
1,3,5[10]-Estratriene-2,4-d2-3,17beta-diol manufacturers
|
| | 1,3,5[10]-Estratriene-2,4-d2-3,17beta-diol Basic information |
| Product Name: | 1,3,5[10]-Estratriene-2,4-d2-3,17beta-diol | | Synonyms: | 17BETA-ESTRADIOL-D2;17BETA-ESTRADIOL-2,4-D2;2,4-dideuterioestradiol;5(10)-triene-2,4-d2-3,17-diol,(17-beta)-estra-3;17B-estradiol-D2 98 atom % D;1,3,5(10)-estratriene-2,4-d2-3,17β-diol;β-estradiol-d2;oestradiol-d2 | | CAS: | 53866-33-4 | | MF: | C18H24O2 | | MW: | 272.39 | | EINECS: | | | Product Categories: | | | Mol File: | 53866-33-4.mol | ![1,3,5[10]-Estratriene-2,4-d2-3,17beta-diol Structure](CAS/GIF/53866-33-4.gif) |
| | 1,3,5[10]-Estratriene-2,4-d2-3,17beta-diol Chemical Properties |
| Melting point | 177 - 179°C | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Sonicated) | | form | Solid | | color | White to Off-White | | InChI | 1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1/i3D,10D | | InChIKey | VOXZDWNPVJITMN-JXCLBMSPSA-N | | SMILES | [H][C@]12CC[C@]3(C)[C@@H](O)CC[C@@]3([H])[C@]1([H])CCc4c([2H])c(O)c([2H])cc24 |
| Hazard Codes | T | | Risk Statements | 45-46-61-20/21/22 | | Safety Statements | 53-22-36/37/39-45 | | WGK Germany | 3 | | RTECS | KG6814500 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Lact. Repr. 1A |
| | 1,3,5[10]-Estratriene-2,4-d2-3,17beta-diol Usage And Synthesis |
| Uses | 17beta-Estradiol-2,4-d2 (CAS# 53866-33-4) is a useful isotopically labeled research compound. |
| | 1,3,5[10]-Estratriene-2,4-d2-3,17beta-diol Preparation Products And Raw materials |
|