|
|
| | Benzyl alpha-D-mannopyranoside Basic information |
| | Benzyl alpha-D-mannopyranoside Chemical Properties |
| Melting point | 126-129°C | | Boiling point | 480.2±45.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 12.93±0.70(Predicted) | | color | White | | InChI | InChI=1/C13H18O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10-,11+,12+,13+/s3 | | InChIKey | GKHCBYYBLTXYEV-VVEVHEMZNA-N | | SMILES | [C@@H]1(OCC2=CC=CC=C2)[C@@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:0,9,11,12,14,r| | | CAS DataBase Reference | 15548-45-5(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29389090 |
| | Benzyl alpha-D-mannopyranoside Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | Phenylmethyl α-D-mannopyranoside is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1]. | | References | [1] Varki A, et al editors. Essentials of Glycobiology [Internet]. 4th ed. Cold Spring Harbor (NY): Cold Spring Harbor Laboratory Press; 2022. PMID:35536922 |
| | Benzyl alpha-D-mannopyranoside Preparation Products And Raw materials |
|