|
|
| | 4-(4-Nitrobenzyl)pyridine Basic information |
| | 4-(4-Nitrobenzyl)pyridine Chemical Properties |
| Melting point | 69-71 °C (lit.) | | Boiling point | 354.35°C (rough estimate) | | density | 1.2042 (rough estimate) | | refractive index | 1.6660 (estimate) | | storage temp. | Store below +30°C. | | form | Crystals or Crystalline Powder | | pka | 5.51±0.10(Predicted) | | color | Light yellow | | Water Solubility | Soluble in acetone. Insoluble in water. | | Sensitive | Light Sensitive | | BRN | 170877 | | InChI | 1S/C12H10N2O2/c15-14(16)12-3-1-10(2-4-12)9-11-5-7-13-8-6-11/h1-8H,9H2 | | InChIKey | MNHKUCBXXMFQDM-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(Cc2ccncc2)cc1 | | CAS DataBase Reference | 1083-48-3(CAS DataBase Reference) | | NIST Chemistry Reference | Pyridine, 4-[(4-nitrophenyl)methyl]-(1083-48-3) | | EPA Substance Registry System | Pyridine, 4-[(4-nitrophenyl)methyl]- (1083-48-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | UT6360000 | | F | 10-23 | | TSCA | TSCA listed | | HS Code | 29333999 | | Storage Class | 13 - Non Combustible Solids |
| | 4-(4-Nitrobenzyl)pyridine Usage And Synthesis |
| Chemical Properties | LIGHT YELLOW CRYSTALS OR CRYSTALLINE POWDER | | Uses | 4-(4-Nitrobenzyl)pyridine is used in tests for alkylating agents1 and in a spectroscopic method for phosgene determination.2 | | Uses | 4-(4-Nitrobenzyl)pyridine is a chemical used for the detection of epoxides and methylating reagents. | | Uses | 4-(4-Nitrobenzyl)pyridine is used in spectroscopic method for the determination of phosgene. It is also used in tests for alkylating agents. | | Purification Methods | Crystallise PNBP from aqueous EtOH or cyclohexane. The hydrochloride has m 194-196o(dec, from EtOH), and the picrate has m 168o(dec, from EtOH/EtOAc). [Beilstein 20 II 272, 20/7 V 564.] |
| | 4-(4-Nitrobenzyl)pyridine Preparation Products And Raw materials |
|