|
|
| | (R)-(-)-3-Quinuclidinol Basic information |
| | (R)-(-)-3-Quinuclidinol Chemical Properties |
| Melting point | 217-224 °C | | alpha | -44.5 º (c=3, 1N HCl) | | Boiling point | 120 °C (20.2527 mmHg) | | density | 1.0083 (rough estimate) | | vapor pressure | 0.006-0.016Pa at 20-25℃ | | refractive index | 1.4830 (estimate) | | storage temp. | Flammables area | | pka | 14.75±0.20(Predicted) | | form | Crystalline Powder | | color | White to faintly beige | | Water Solubility | 100 g/100 mL | | InChI | InChI=1S/C7H13NO/c9-7-5-8-3-1-6(7)2-4-8/h6-7,9H,1-5H2/t7-/m0/s1 | | InChIKey | IVLICPVPXWEGCA-ZETCQYMHSA-N | | SMILES | N12CCC(CC1)[C@@H](O)C2 | | LogP | -2.8 at 20℃ and pH7 | | CAS DataBase Reference | 25333-42-0(CAS DataBase Reference) |
| | (R)-(-)-3-Quinuclidinol Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Hypotensive. Synthon for preparation of cholinergic receptor ligands and anesthetics | | Uses | Sitagliptin phosphateintermediate |
| | (R)-(-)-3-Quinuclidinol Preparation Products And Raw materials |
|