|
|
| | 3-Cyano-7-ethoxycoumarin Basic information |
| | 3-Cyano-7-ethoxycoumarin Chemical Properties |
| Melting point | 210-212°C | | Boiling point | 396.8±42.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble | | form | Solid | | color | yellow to orange | | λmax | 356 nm (Buffer pH7); 355 nm(MeOH) | | Biological Applications | As a substrate for
measuring cytochrome P450 enzymes activity;
cytochrome P450 inhibition assays;
drug design;
drug metabolism;
treating viral or parasite
infections. | | InChI | InChI=1S/C12H9NO3/c1-2-15-10-4-3-8-5-9(7-13)12(14)16-11(8)6-10/h3-6H,2H2,1H3 | | InChIKey | YAFGHMIAFYQSCF-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=CC(OCC)=CC=C2C=C1C#N |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Cyano-7-ethoxycoumarin Usage And Synthesis |
| Uses | Substrate for determination of cytochrom P-450 dependent oxidases; about 50-100 times more sensitive than conventional substrate ethoxy-resorufin due to higher turn over rate. | | Uses | 3-Cyano-7-ethoxycoumarin has been used as a substrate in cytochrome P (CYP) inhibition for fluorescence measurement. | | General Description | 3-Cyano-7-ethoxycoumarin is a fluorescent substrate for Cytochrome P450 1A1 (CYP1A1), Cytochrome P450 1A2 (CYP1A2), Cytochrome P450 2C9 (CYP2C9) and Cytochrome P450 2C19 (CYP2C19). | | Biochem/physiol Actions | Fluorescent probe useful in microsomal dealkylase studies. Typical drug-drug interactions resulting from enzyme inhibition. |
| | 3-Cyano-7-ethoxycoumarin Preparation Products And Raw materials |
|