|
|
| | (3R,6R)-3,6-Octanediol Basic information |
| Product Name: | (3R,6R)-3,6-Octanediol | | Synonyms: | (3R,6R)-(-)-3,6-Octanediol,99%;(3R,6R)-3,6-OCTANEDIOL, 95%, (98% EE);(R,R)-3,6-OCTANEDIOL;(R,R)-octane-3,6-diol;(3R,6R)-3,6-Octanediol;(3R,6R)-DIHYDROXYOCTANE;(3R,6R)-OCTANE-3,6-DIOL;(3R,6R)-3,6-DIHYDROXYOCTANE | | CAS: | 129619-37-0 | | MF: | C8H18O2 | | MW: | 146.23 | | EINECS: | | | Product Categories: | Chiral Building Blocks;Simple Alcohols (Chiral);Synthetic Organic Chemistry;Chiral Building Blocks;Organic Building Blocks;Polyols;organic alcohol;Chiral Compounds;Diols;129619-37-0 | | Mol File: | 129619-37-0.mol |  |
| | (3R,6R)-3,6-Octanediol Chemical Properties |
| Melting point | 49-51°C | | alpha | -15° (c 10, ethanol) | | Boiling point | 243.79°C (rough estimate) | | density | 0.9636 (rough estimate) | | refractive index | 1.4411 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 14.86±0.20(Predicted) | | form | Needle-Like Crystals | | color | Off-white | | InChI | InChI=1S/C8H18O2/c1-3-7(9)5-6-8(10)4-2/h7-10H,3-6H2,1-2H3/t7-,8-/m1/s1 | | InChIKey | BCKOQWWRTRBSGR-HTQZYQBOSA-N | | SMILES | CC[C@@H](O)CC[C@H](O)CC | | CAS DataBase Reference | 129619-37-0(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29053995 |
| | (3R,6R)-3,6-Octanediol Usage And Synthesis |
| Chemical Properties | off-white needle-like crystals | | Uses | (3R,6R)-3,6-Octanediol can be useful in the preparation of chiral sulfonium reagents and stereoselective addn. to alkenes. |
| | (3R,6R)-3,6-Octanediol Preparation Products And Raw materials |
|