1,1,1-Trifluoro-6-methylheptane-2,4-dione manufacturers
|
| | 1,1,1-Trifluoro-6-methylheptane-2,4-dione Basic information |
| Product Name: | 1,1,1-Trifluoro-6-methylheptane-2,4-dione | | Synonyms: | AKOS MSC-0324;1,1,1-Trifluoro-6-methyl-2,4-heptanedione;1,1,1-TRIFLUORO-6-METHYLHEPTANE-2,4-DIONE, 98% MIN.;6-Methyl-1,1,1-trifluoroheptane-2,4-dione;4-Methyl-1-(trifluoroacetyl)pentan-2-one, 2,4-Dioxo-6-methyl-1,1,1-trifluoroheptane;XWBVTGFPQXBNOZ-UHFFFAOYSA-N;2,4-Heptanedione, 1,1,1-trifluoro-6-methyl-;1,1,1-Trifluoro-6-methylheptane-2,4-dione | | CAS: | 461-92-7 | | MF: | C8H11F3O2 | | MW: | 196.17 | | EINECS: | 2073196 | | Product Categories: | | | Mol File: | 461-92-7.mol |  |
| | 1,1,1-Trifluoro-6-methylheptane-2,4-dione Chemical Properties |
| Boiling point | 78 °C(Press: 64 Torr) | | density | 1.13 g/cm3 | | storage temp. | Store at room temperature | | pka | 6.47±0.10(Predicted) | | form | solid | | color | Pale brown/light yellow | | InChI | InChI=1S/C8H11F3O2/c1-5(2)3-6(12)4-7(13)8(9,10)11/h5H,3-4H2,1-2H3 | | InChIKey | XWBVTGFPQXBNOZ-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(=O)CC(=O)CC(C)C | | EPA Substance Registry System | 2,4-Heptanedione, 1,1,1-trifluoro-6-methyl- (461-92-7) |
| TSCA | TSCA listed | | HS Code | 2914199090 |
| | 1,1,1-Trifluoro-6-methylheptane-2,4-dione Usage And Synthesis |
| | 1,1,1-Trifluoro-6-methylheptane-2,4-dione Preparation Products And Raw materials |
|